EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H4NO2 |
| Net Charge | -1 |
| Average Mass | 74.059 |
| Monoisotopic Mass | 74.02475 |
| SMILES | CC=[N+]([O-])[O-] |
| InChI | InChI=1S/C2H4NO2/c1-2-3(4)5/h2H,1H3/q-1 |
| InChIKey | YERBBVNYIKLXDM-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aci-nitroethane(1−) (CHEBI:55327) is a nitrogen oxoanion (CHEBI:33458) |
| aci-nitroethane(1−) (CHEBI:55327) is conjugate base of aci-nitroethane (CHEBI:77894) |
| Incoming Relation(s) |
| aci-nitroethane (CHEBI:77894) is conjugate acid of aci-nitroethane(1−) (CHEBI:55327) |
| IUPAC Name |
|---|
| [ethylidene(oxido)-λ5-azanyl]oxidanide |
| Synonyms | Source |
|---|---|
| Nitroethane aci-anion | ChemIDplus |
| Nitroethane anion | ChemIDplus |
| aci-Nitroethane ion(1-) | ChemIDplus |
| Ethanenitronate | ChemIDplus |
| ethylnitronate(1−) | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C18091 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:25590-58-3 | ChemIDplus |
| Citations |
|---|