EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20NO3 |
| Net Charge | +1 |
| Average Mass | 298.362 |
| Monoisotopic Mass | 298.14377 |
| SMILES | COC1=CC=C2[C@H]3Cc4ccc(O)c5c4[C@@]2(CC[NH+]3C)[C@H]1O5 |
| InChI | InChI=1S/C18H19NO3/c1-19-8-7-18-11-4-6-14(21-2)17(18)22-16-13(20)5-3-10(15(16)18)9-12(11)19/h3-6,12,17,20H,7-9H2,1-2H3/p+1/t12-,17+,18+/m1/s1 |
| InChIKey | ZKLXUUYLEHCAMF-UUWFMWQGSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oripavine(1+) (CHEBI:194499) is a ammonium ion derivative (CHEBI:35274) |
| oripavine(1+) (CHEBI:194499) is a organic cation (CHEBI:25697) |
| oripavine(1+) (CHEBI:194499) is conjugate acid of oripavine (CHEBI:7782) |
| Incoming Relation(s) |
| oripavine (CHEBI:7782) is conjugate base of oripavine(1+) (CHEBI:194499) |
| IUPAC Name |
|---|
| 3-hydroxy-6-methoxy-17-methyl-5α-6,7,8,14-tetradehydro-4,5-epoxymorphinan-17-ium |
| Synonyms | Source |
|---|---|
| 3-O-demethylthebaine(1+) | ChEBI |
| 3-O-demethylthebaine cation | ChEBI |
| oripavine cation | ChEBI |
| UniProt Name | Source |
|---|---|
| oripavine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-7713 | MetaCyc |
| Citations |
|---|