EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H38N2O4 |
| Net Charge | 0 |
| Average Mass | 454.611 |
| Monoisotopic Mass | 454.28316 |
| SMILES | COc1ccc(CCN(C)CCC[C@@](C#N)(c2ccc(OC)c(OC)c2)C(C)C)cc1OC |
| InChI | InChI=1S/C27H38N2O4/c1-20(2)27(19-28,22-10-12-24(31-5)26(18-22)33-7)14-8-15-29(3)16-13-21-9-11-23(30-4)25(17-21)32-6/h9-12,17-18,20H,8,13-16H2,1-7H3/t27-/m0/s1 |
| InChIKey | SGTNSNPWRIOYBX-MHZLTWQESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-verapamil (CHEBI:77736) is a 2-(3,4-dimethoxyphenyl)-5-{[2-(3,4-dimethoxyphenyl)ethyl](methyl)amino}-2-(propan-2-yl)pentanenitrile (CHEBI:77733) |
| (S)-verapamil (CHEBI:77736) is conjugate base of (S)-verapamil(1+) (CHEBI:77738) |
| (S)-verapamil (CHEBI:77736) is enantiomer of dexverapamil (CHEBI:77734) |
| Incoming Relation(s) |
| verapamil (CHEBI:9948) has part (S)-verapamil (CHEBI:77736) |
| (S)-verapamil(1+) (CHEBI:77738) is conjugate acid of (S)-verapamil (CHEBI:77736) |
| dexverapamil (CHEBI:77734) is enantiomer of (S)-verapamil (CHEBI:77736) |
| IUPAC Name |
|---|
| (2S)-2-(3,4-dimethoxyphenyl)-5-{[2-(3,4-dimethoxyphenyl)ethyl](methyl)amino}-2-(propan-2-yl)pentanenitrile |
| Synonyms | Source |
|---|---|
| (−)-2-(3,4-dimethoxyphenyl)-5-{[2-(3,4-dimethoxyphenyl)ethyl](methyl)amino}-2-(propan-2-yl)pentanenitrile | ChEBI |
| (S)-(−)-verapamil | ChEBI |
| (−)-(S)-verapamil | ChEBI |
| (−)-verapamil | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5314473 | Reaxys |