EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H38N2O4 |
| Net Charge | 0 |
| Average Mass | 454.611 |
| Monoisotopic Mass | 454.28316 |
| SMILES | COc1ccc(CCN(C)CCC[C@](C#N)(c2ccc(OC)c(OC)c2)C(C)C)cc1OC |
| InChI | InChI=1S/C27H38N2O4/c1-20(2)27(19-28,22-10-12-24(31-5)26(18-22)33-7)14-8-15-29(3)16-13-21-9-11-23(30-4)25(17-21)32-6/h9-12,17-18,20H,8,13-16H2,1-7H3/t27-/m1/s1 |
| InChIKey | SGTNSNPWRIOYBX-HHHXNRCGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 3.6.3.44 (xenobiotic-transporting ATPase) inhibitor An EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that interferes with the action of xenobiotic-transporting ATPase (EC 3.6.3.44). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dexverapamil (CHEBI:77734) has role EC 3.6.3.44 (xenobiotic-transporting ATPase) inhibitor (CHEBI:77748) |
| dexverapamil (CHEBI:77734) is a 2-(3,4-dimethoxyphenyl)-5-{[2-(3,4-dimethoxyphenyl)ethyl](methyl)amino}-2-(propan-2-yl)pentanenitrile (CHEBI:77733) |
| dexverapamil (CHEBI:77734) is conjugate base of dexverapamil(1+) (CHEBI:77737) |
| dexverapamil (CHEBI:77734) is enantiomer of (S)-verapamil (CHEBI:77736) |
| Incoming Relation(s) |
| verapamil (CHEBI:9948) has part dexverapamil (CHEBI:77734) |
| dexverapamil(1+) (CHEBI:77737) is conjugate acid of dexverapamil (CHEBI:77734) |
| (S)-verapamil (CHEBI:77736) is enantiomer of dexverapamil (CHEBI:77734) |
| IUPAC Name |
|---|
| (2R)-2-(3,4-dimethoxyphenyl)-5-{[2-(3,4-dimethoxyphenyl)ethyl](methyl)amino}-2-(propan-2-yl)pentanenitrile |
| INNs | Source |
|---|---|
| dexverapamil | WHO MedNet |
| dexvérapamil | WHO MedNet |
| dexverapamilo | WHO MedNet |
| dexverapamilum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (+)-2-(3,4-dimethoxyphenyl)-5-{[2-(3,4-dimethoxyphenyl)ethyl](methyl)amino}-2-(propan-2-yl)pentanenitrile | ChEBI |
| (+)-(2R)-2-(3,4-dimethoxyphenyl)-5-{[2-(3,4-dimethoxyphenyl)ethyl](methyl)amino}-2-(propan-2-yl)pentanenitrile | ChEBI |
| (2R)-(+)-2-(3,4-dimethoxyphenyl)-5-{[2-(3,4-dimethoxyphenyl)ethyl](methyl)amino}-2-(propan-2-yl)pentanenitrile | ChEBI |
| (+)-3-(3,4-dimethoxyphenyl)-6-((5,6-dimethoxyphenethyl)methylamino)hexane-3-carbonitrile | ChEBI |
| (+)-(R)-5-((3,4-dimethoxyphenethyl)methylamino)-2-(3,4-dimethoxyphenyl)-2-isopropylvaleronitrile | ChemIDplus |
| (+)-(R)-verapamil | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3657914 | Reaxys |
| CAS:38321-02-7 | ChemIDplus |
| Citations |
|---|