EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H39N2O4 |
| Net Charge | +1 |
| Average Mass | 455.619 |
| Monoisotopic Mass | 455.29043 |
| SMILES | COc1ccc(CC[NH+](C)CCC[C@@](C#N)(c2ccc(OC)c(OC)c2)C(C)C)cc1OC |
| InChI | InChI=1S/C27H38N2O4/c1-20(2)27(19-28,22-10-12-24(31-5)26(18-22)33-7)14-8-15-29(3)16-13-21-9-11-23(30-4)25(17-21)32-6/h9-12,17-18,20H,8,13-16H2,1-7H3/p+1/t27-/m0/s1 |
| InChIKey | SGTNSNPWRIOYBX-MHZLTWQESA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-verapamil(1+) (CHEBI:77738) is a ammonium ion derivative (CHEBI:35274) |
| (S)-verapamil(1+) (CHEBI:77738) is conjugate acid of (S)-verapamil (CHEBI:77736) |
| (S)-verapamil(1+) (CHEBI:77738) is enantiomer of dexverapamil(1+) (CHEBI:77737) |
| Incoming Relation(s) |
| (S)-verapamil (CHEBI:77736) is conjugate base of (S)-verapamil(1+) (CHEBI:77738) |
| dexverapamil(1+) (CHEBI:77737) is enantiomer of (S)-verapamil(1+) (CHEBI:77738) |
| IUPAC Name |
|---|
| (4S)-4-cyano-4-(3,4-dimethoxyphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N,5-dimethylhexan-1-aminium |
| Synonym | Source |
|---|---|
| (S)-verapamil(1+) | ChEBI |