EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10N2O6 |
| Net Charge | 0 |
| Average Mass | 302.242 |
| Monoisotopic Mass | 302.05389 |
| SMILES | O=C(O)c1cc(N=Nc2ccc(O)c(C(=O)O)c2)ccc1O |
| InChI | InChI=1S/C14H10N2O6/c17-11-3-1-7(5-9(11)13(19)20)15-16-8-2-4-12(18)10(6-8)14(21)22/h1-6,17-18H,(H,19,20)(H,21,22) |
| InChIKey | QQBDLJCYGRGAKP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| olsalazine (CHEBI:7770) has functional parent salicylic acid (CHEBI:16914) |
| olsalazine (CHEBI:7770) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| olsalazine (CHEBI:7770) has role prodrug (CHEBI:50266) |
| olsalazine (CHEBI:7770) is a azobenzenes (CHEBI:22682) |
| olsalazine (CHEBI:7770) is a dicarboxylic acid (CHEBI:35692) |
| olsalazine (CHEBI:7770) is conjugate acid of olsalazine(2−) (CHEBI:63719) |
| Incoming Relation(s) |
| olsalazine(2−) (CHEBI:63719) is conjugate base of olsalazine (CHEBI:7770) |
| IUPAC Name |
|---|
| 3,3'-diazene-1,2-diylbis(6-hydroxybenzoic acid) |
| INN | Source |
|---|---|
| olsalazine | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 3,3'-Azobis(6-hydroxybenzoic acid) | ChemIDplus |
| 5,5'-Azobis(salicylic acid) | ChemIDplus |
| Olsalazina | ChemIDplus |
| Olsalazine | KEGG COMPOUND |
| Olsalazinum | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3218651 | Reaxys |
| CAS:15722-48-2 | ChemIDplus |
| CAS:15722-48-2 | KEGG COMPOUND |