EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H8N2O6 |
| Net Charge | -2 |
| Average Mass | 300.226 |
| Monoisotopic Mass | 300.03933 |
| SMILES | O=C([O-])c1cc(N=Nc2ccc(O)c(C(=O)[O-])c2)ccc1O |
| InChI | InChI=1S/C14H10N2O6/c17-11-3-1-7(5-9(11)13(19)20)15-16-8-2-4-12(18)10(6-8)14(21)22/h1-6,17-18H,(H,19,20)(H,21,22)/p-2 |
| InChIKey | QQBDLJCYGRGAKP-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| olsalazine(2−) (CHEBI:63719) is a dicarboxylic acid dianion (CHEBI:28965) |
| olsalazine(2−) (CHEBI:63719) is conjugate base of olsalazine (CHEBI:7770) |
| Incoming Relation(s) |
| olsalazine sodium (CHEBI:63614) has part olsalazine(2−) (CHEBI:63719) |
| olsalazine (CHEBI:7770) is conjugate acid of olsalazine(2−) (CHEBI:63719) |
| IUPAC Name |
|---|
| 3,3'-diazene-1,2-diylbis(6-hydroxybenzoate) |
| Synonyms | Source |
|---|---|
| olsalazinate(2−) | ChEBI |
| olsalazinate dianion | ChEBI |
| olsalazine dianion | ChEBI |