EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H11O5 |
| Net Charge | -1 |
| Average Mass | 271.248 |
| Monoisotopic Mass | 271.06120 |
| SMILES | O=C(/C=C/c1ccc(O)cc1)c1c([O-])cc(O)cc1O |
| InChI | InChI=1S/C15H12O5/c16-10-4-1-9(2-5-10)3-6-12(18)15-13(19)7-11(17)8-14(15)20/h1-8,16-17,19-20H/p-1/b6-3+ |
| InChIKey | YQHMWTPYORBCMF-ZZXKWVIFSA-M |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. anti-allergic agent A drug used to treat allergic reactions. anti-inflammatory agent Any compound that has anti-inflammatory effects. anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2',4,4',6'-tetrahydroxychalcone(1−) (CHEBI:77645) has role anti-allergic agent (CHEBI:50857) |
| 2',4,4',6'-tetrahydroxychalcone(1−) (CHEBI:77645) has role anti-inflammatory agent (CHEBI:67079) |
| 2',4,4',6'-tetrahydroxychalcone(1−) (CHEBI:77645) has role metabolite (CHEBI:25212) |
| 2',4,4',6'-tetrahydroxychalcone(1−) (CHEBI:77645) is a 2-acyl-4-prenylphloroglucinol(1−) (CHEBI:134371) |
| 2',4,4',6'-tetrahydroxychalcone(1−) (CHEBI:77645) is a 2',4,4',6'-tetrahydroxychalcone (CHEBI:15413) |
| 2',4,4',6'-tetrahydroxychalcone(1−) (CHEBI:77645) is a phenolate anion (CHEBI:50525) |
| IUPAC Name |
|---|
| 3,5-dihydroxy-2-[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]phenolate |