EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12O4R |
| Net Charge | -1 |
| Average Mass (excl. R groups) | 220.222 |
| Monoisotopic Mass (excl. R groups) | 220.07356 |
| SMILES | *C(=O)c1c(O)cc(O)c(CC=C(C)C)c1[O-] |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-acyl-4-prenylphloroglucinol(1−) (CHEBI:134371) is a phenolate anion (CHEBI:50525) |
| 2-acyl-4-prenylphloroglucinol(1−) (CHEBI:134371) is conjugate base of 2-acyl-4-prenylphloroglucinol (CHEBI:134339) |
| Incoming Relation(s) |
| 2',4,4',6'-tetrahydroxychalcone(1−) (CHEBI:77645) is a 2-acyl-4-prenylphloroglucinol(1−) (CHEBI:134371) |
| 2-acyl-4-prenylphloroglucinol (CHEBI:134339) is conjugate acid of 2-acyl-4-prenylphloroglucinol(1−) (CHEBI:134371) |
| UniProt Name | Source |
|---|---|
| a 2-acyl-4-prenylphloroglucinol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-19787 | MetaCyc |