EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O5 |
| Net Charge | 0 |
| Average Mass | 272.256 |
| Monoisotopic Mass | 272.06847 |
| SMILES | O=C(/C=C/c1ccc(O)cc1)c1c(O)cc(O)cc1O |
| InChI | InChI=1S/C15H12O5/c16-10-4-1-9(2-5-10)3-6-12(18)15-13(19)7-11(17)8-14(15)20/h1-8,16-17,19-20H/b6-3+ |
| InChIKey | YQHMWTPYORBCMF-ZZXKWVIFSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | anti-allergic agent A drug used to treat allergic reactions. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2',4,4',6'-tetrahydroxychalcone (CHEBI:15413) has functional parent trans-chalcone (CHEBI:48965) |
| 2',4,4',6'-tetrahydroxychalcone (CHEBI:15413) has role anti-allergic agent (CHEBI:50857) |
| 2',4,4',6'-tetrahydroxychalcone (CHEBI:15413) has role anti-inflammatory agent (CHEBI:67079) |
| 2',4,4',6'-tetrahydroxychalcone (CHEBI:15413) has role metabolite (CHEBI:25212) |
| 2',4,4',6'-tetrahydroxychalcone (CHEBI:15413) is a (E)-2'-hydroxy-chalcones (CHEBI:231427) |
| 2',4,4',6'-tetrahydroxychalcone (CHEBI:15413) is a chalcones (CHEBI:23086) |
| 2',4,4',6'-tetrahydroxychalcone (CHEBI:15413) is a polyphenol (CHEBI:26195) |
| Incoming Relation(s) |
| 2',4,4',6'-tetrahydroxychalcone 4'-O-β-D-glucoside (CHEBI:66906) has functional parent 2',4,4',6'-tetrahydroxychalcone (CHEBI:15413) |
| 2',4,4',6'-tetrahydroxychalcone(1−) (CHEBI:77645) is a 2',4,4',6'-tetrahydroxychalcone (CHEBI:15413) |
| IUPAC Name |
|---|
| (2E)-3-(4-hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)prop-2-en-1-one |
| Synonyms | Source |
|---|---|
| 2',4,4',6'-Tetrahydroxychalcone | KEGG COMPOUND |
| 2',4',6',4-tetrahydroxychalcone | ChEBI |
| 2'4'6'4-Tetrahydroxychalcone | KEGG COMPOUND |
| Chalconaringenin | KEGG COMPOUND |
| Chalconaringenin | ChemIDplus |
| Isosalipurpol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 2',4,4',6'-tetrahydroxychalcone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00007233 | KNApSAcK |
| C06561 | KEGG COMPOUND |
| LMPK12120264 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2335724 | Reaxys |
| CAS:73692-50-9 | ChemIDplus |
| Citations |
|---|