EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21N2O2 |
| Net Charge | +1 |
| Average Mass | 285.367 |
| Monoisotopic Mass | 285.15975 |
| SMILES | [H][C@]12CC[C@]([H])(C[C@H](OC(=O)c3cnc4ccccc34)C1)[NH+]2C |
| InChI | InChI=1S/C17H20N2O2/c1-19-11-6-7-12(19)9-13(8-11)21-17(20)15-10-18-16-5-3-2-4-14(15)16/h2-5,10-13,18H,6-9H2,1H3/p+1/t11-,12+,13+ |
| InChIKey | ZNRGQMMCGHDTEI-ITGUQSILSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tropisetron(1+) (CHEBI:77571) is a ammonium ion derivative (CHEBI:35274) |
| tropisetron(1+) (CHEBI:77571) is a organic cation (CHEBI:25697) |
| tropisetron(1+) (CHEBI:77571) is conjugate acid of tropisetron (CHEBI:32269) |
| Incoming Relation(s) |
| tropisetron hydrochloride (CHEBI:77570) has part tropisetron(1+) (CHEBI:77571) |
| tropisetron (CHEBI:32269) is conjugate base of tropisetron(1+) (CHEBI:77571) |
| IUPAC Name |
|---|
| (3-endo,8-syn)-3-[(1H-indol-3-ylcarbonyl)oxy]-8-methyl-8-azoniabicyclo[3.2.1]octane |
| Synonym | Source |
|---|---|
| tropisetron cation | ChEBI |