EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:77570 - tropisetron hydrochloride
| Formula | C17H20N2O2.HCl |
| Net Charge | 0 |
| Average Mass | 320.820 |
| Monoisotopic Mass | 320.12916 |
| SMILES | Cl.[H][C@]12CC[C@]([H])(C[C@H](OC(=O)c3cnc4ccccc34)C1)N2C |
| InChI | InChI=1S/C17H20N2O2.ClH/c1-19-11-6-7-12(19)9-13(8-11)21-17(20)15-10-18-16-5-3-2-4-14(15)16;/h2-5,10-13,18H,6-9H2,1H3;1H/t11-,12+,13+; |
| InChIKey | XIEGSJAEZIGKSA-LUNMCBQDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. anti-inflammatory agent Any compound that has anti-inflammatory effects. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tropisetron hydrochloride (CHEBI:77570) has part tropisetron(1+) (CHEBI:77571) |
| tropisetron hydrochloride (CHEBI:77570) has role anti-inflammatory agent (CHEBI:67079) |
| tropisetron hydrochloride (CHEBI:77570) has role antiemetic (CHEBI:50919) |
| tropisetron hydrochloride (CHEBI:77570) has role apoptosis inhibitor (CHEBI:68494) |
| tropisetron hydrochloride (CHEBI:77570) has role immunomodulator (CHEBI:50846) |
| tropisetron hydrochloride (CHEBI:77570) has role neuroprotective agent (CHEBI:63726) |
| tropisetron hydrochloride (CHEBI:77570) has role nicotinic acetylcholine receptor agonist (CHEBI:47958) |
| tropisetron hydrochloride (CHEBI:77570) has role serotonergic antagonist (CHEBI:48279) |
| tropisetron hydrochloride (CHEBI:77570) has role trypanocidal drug (CHEBI:36335) |
| tropisetron hydrochloride (CHEBI:77570) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| (3-endo,8-syn)-3-[(1H-indol-3-ylcarbonyl)oxy]-8-methyl-8-azoniabicyclo[3.2.1]octane chloride |
| (3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl 1H-indole-3-carboxylate hydrochloride |
| Synonyms | Source |
|---|---|
| Tropisetron HCl | ChemIDplus |
| Tropisetron monohydrochloride | ChemIDplus |
| Brand Name | Source |
|---|---|
| Navoban | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| CN101278921 | Patent |
| CN101444508 | Patent |
| CN1682721 | Patent |
| D02041 | KEGG DRUG |
| Tropisetron | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11257467 | Reaxys |
| CAS:105826-92-4 | ChemIDplus |
| CAS:105826-92-4 | KEGG DRUG |
| Citations |
|---|