EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20N2O2.HCl |
| Net Charge | 0 |
| Average Mass | 320.820 |
| Monoisotopic Mass | 320.12916 |
| SMILES | Cl.[H][C@]12CC[C@]([H])(C[C@H](OC(=O)c3cnc4ccccc34)C1)N2C |
| InChI | InChI=1S/C17H20N2O2.ClH/c1-19-11-6-7-12(19)9-13(8-11)21-17(20)15-10-18-16-5-3-2-4-14(15)16;/h2-5,10-13,18H,6-9H2,1H3;1H/t11-,12+,13+; |
| InChIKey | XIEGSJAEZIGKSA-LUNMCBQDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tropisetron hydrochloride (CHEBI:77570) has part tropisetron(1+) (CHEBI:77571) |
| tropisetron hydrochloride (CHEBI:77570) has role anti-inflammatory agent (CHEBI:67079) |
| tropisetron hydrochloride (CHEBI:77570) has role antiemetic (CHEBI:50919) |
| tropisetron hydrochloride (CHEBI:77570) has role apoptosis inhibitor (CHEBI:68494) |
| tropisetron hydrochloride (CHEBI:77570) has role immunomodulator (CHEBI:50846) |
| tropisetron hydrochloride (CHEBI:77570) has role neuroprotective agent (CHEBI:63726) |
| tropisetron hydrochloride (CHEBI:77570) has role nicotinic acetylcholine receptor agonist (CHEBI:47958) |
| tropisetron hydrochloride (CHEBI:77570) has role serotonergic antagonist (CHEBI:48279) |
| tropisetron hydrochloride (CHEBI:77570) has role trypanocidal drug (CHEBI:36335) |
| tropisetron hydrochloride (CHEBI:77570) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| (3-endo,8-syn)-3-[(1H-indol-3-ylcarbonyl)oxy]-8-methyl-8-azoniabicyclo[3.2.1]octane chloride |
| (3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl 1H-indole-3-carboxylate hydrochloride |
| Synonyms | Source |
|---|---|
| Tropisetron HCl | ChemIDplus |
| Tropisetron monohydrochloride | ChemIDplus |
| Brand Name | Source |
|---|---|
| Navoban | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| CN101278921 | Patent |
| CN101444508 | Patent |
| CN1682721 | Patent |
| D02041 | KEGG DRUG |
| Tropisetron | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11257467 | Reaxys |
| CAS:105826-92-4 | ChemIDplus |
| CAS:105826-92-4 | KEGG DRUG |
| Citations |
|---|