EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:77570 - tropisetron hydrochloride
| Formula | C17H20N2O2.HCl |
| Net Charge | 0 |
| Average Mass | 320.820 |
| Monoisotopic Mass | 320.12916 |
| SMILES | Cl.[H][C@]12CC[C@]([H])(C[C@H](OC(=O)c3cnc4ccccc34)C1)N2C |
| InChI | InChI=1S/C17H20N2O2.ClH/c1-19-11-6-7-12(19)9-13(8-11)21-17(20)15-10-18-16-5-3-2-4-14(15)16;/h2-5,10-13,18H,6-9H2,1H3;1H/t11-,12+,13+; |
| InChIKey | XIEGSJAEZIGKSA-LUNMCBQDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. |
| Applications: | antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. anti-inflammatory agent Any compound that has anti-inflammatory effects. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tropisetron hydrochloride (CHEBI:77570) has part tropisetron(1+) (CHEBI:77571) |
| tropisetron hydrochloride (CHEBI:77570) has role anti-inflammatory agent (CHEBI:67079) |
| tropisetron hydrochloride (CHEBI:77570) has role antiemetic (CHEBI:50919) |
| tropisetron hydrochloride (CHEBI:77570) has role apoptosis inhibitor (CHEBI:68494) |
| tropisetron hydrochloride (CHEBI:77570) has role immunomodulator (CHEBI:50846) |
| tropisetron hydrochloride (CHEBI:77570) has role neuroprotective agent (CHEBI:63726) |
| tropisetron hydrochloride (CHEBI:77570) has role nicotinic acetylcholine receptor agonist (CHEBI:47958) |
| tropisetron hydrochloride (CHEBI:77570) has role serotonergic antagonist (CHEBI:48279) |
| tropisetron hydrochloride (CHEBI:77570) has role trypanocidal drug (CHEBI:36335) |
| tropisetron hydrochloride (CHEBI:77570) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| (3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl 1H-indole-3-carboxylate hydrochloride |
| (3-endo,8-syn)-3-[(1H-indol-3-ylcarbonyl)oxy]-8-methyl-8-azoniabicyclo[3.2.1]octane chloride |
| Synonyms | Source |
|---|---|
| Tropisetron monohydrochloride | ChemIDplus |
| Tropisetron HCl | ChemIDplus |
| Brand Name | Source |
|---|---|
| Navoban | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D02041 | KEGG DRUG |
| Tropisetron | Wikipedia |
| CN1682721 | Patent |
| CN101278921 | Patent |
| CN101444508 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11257467 | Reaxys |
| CAS:105826-92-4 | KEGG DRUG |
| CAS:105826-92-4 | ChemIDplus |
| Citations |
|---|