EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H6O7P2 |
| Net Charge | -2 |
| Average Mass | 204.011 |
| Monoisotopic Mass | 203.95997 |
| SMILES | CC(O)(P(=O)([O-])O)P(=O)([O-])O |
| InChI | InChI=1S/C2H8O7P2/c1-2(3,10(4,5)6)11(7,8)9/h3H,1H3,(H2,4,5,6)(H2,7,8,9)/p-2 |
| InChIKey | DBVJJBKOTRCVKF-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etidronic acid(2−) (CHEBI:77356) is a organophosphonate(2−) (CHEBI:71285) |
| etidronic acid(2−) (CHEBI:77356) is conjugate base of etidronic acid (CHEBI:4907) |
| Incoming Relation(s) |
| etidronate disodium (CHEBI:4906) has part etidronic acid(2−) (CHEBI:77356) |
| etidronic acid (CHEBI:4907) is conjugate acid of etidronic acid(2−) (CHEBI:77356) |
| IUPAC Name |
|---|
| (1-hydroxyethane-1,1-diyl)bis[hydrogen (phosphonate)] |
| Synonyms | Source |
|---|---|
| etidronic acid dianion | ChEBI |
| hydroxyethylidenebisphosphonate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3592055 | Reaxys |