EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H8O7P2 |
| Net Charge | 0 |
| Average Mass | 206.027 |
| Monoisotopic Mass | 205.97453 |
| SMILES | CC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C2H8O7P2/c1-2(3,10(4,5)6)11(7,8)9/h3H,1H3,(H2,4,5,6)(H2,7,8,9) |
| InChIKey | DBVJJBKOTRCVKF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. |
| Applications: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etidronic acid (CHEBI:4907) has role antineoplastic agent (CHEBI:35610) |
| etidronic acid (CHEBI:4907) has role bone density conservation agent (CHEBI:50646) |
| etidronic acid (CHEBI:4907) has role chelator (CHEBI:38161) |
| etidronic acid (CHEBI:4907) is a 1,1-bis(phosphonic acid) (CHEBI:77383) |
| etidronic acid (CHEBI:4907) is conjugate acid of etidronic acid(2−) (CHEBI:77356) |
| Incoming Relation(s) |
| etidronic acid(2−) (CHEBI:77356) is conjugate base of etidronic acid (CHEBI:4907) |
| IUPAC Name |
|---|
| (1-hydroxyethane-1,1-diyl)bis(phosphonic acid) |
| INNs | Source |
|---|---|
| acide étidronique | WHO MedNet |
| ácido etidrónico | WHO MedNet |
| acidum etidronicum | DrugBank |
| etidronic acid | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 1,1,1-Ethanetriol diphosphonate | ChemIDplus |
| 1-Hydroxy-1,1-diphosphonoethane | ChemIDplus |
| 1-Hydroxyethane-1,1-bisphosphonic acid | ChemIDplus |
| 1-Hydroxyethane-1,1-diphosphonate | ChemIDplus |
| 1-Hydroxyethane-1,1-diphosphonic acid | ChemIDplus |
| 1-Hydroxyethanediphosphonic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1789291 | Reaxys |
| CAS:2809-21-4 | KEGG COMPOUND |
| CAS:2809-21-4 | ChemIDplus |
| Citations |
|---|