EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H6O7P2.2Na |
| Net Charge | 0 |
| Average Mass | 249.991 |
| Monoisotopic Mass | 249.93841 |
| SMILES | CC(O)(P(=O)([O-])O)P(=O)([O-])O.[Na+].[Na+] |
| InChI | InChI=1S/C2H8O7P2.2Na/c1-2(3,10(4,5)6)11(7,8)9;;/h3H,1H3,(H2,4,5,6)(H2,7,8,9);;/q;2*+1/p-2 |
| InChIKey | GWBBVOVXJZATQQ-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Chemical Role: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. |
| Applications: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etidronate disodium (CHEBI:4906) has part etidronic acid(2−) (CHEBI:77356) |
| etidronate disodium (CHEBI:4906) has role antineoplastic agent (CHEBI:35610) |
| etidronate disodium (CHEBI:4906) has role bone density conservation agent (CHEBI:50646) |
| etidronate disodium (CHEBI:4906) has role chelator (CHEBI:38161) |
| etidronate disodium (CHEBI:4906) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium (1-hydroxyethane-1,1-diyl)bis[hydrogen (phosphonate)] |
| Synonyms | Source |
|---|---|
| (1-hydroxyethane-1,1-diyl)diphosphonic acid disodium salt | ChemIDplus |
| 1-hydroxyethylidene-1,1-diphosphonic acid disodium salt | ChemIDplus |
| (1-hydroxyethylidene)diphosphonic acid, disodium salt | ChemIDplus |
| disodium (1-hydroxyethylidene)diphosphonate | ChemIDplus |
| disodium 1-hydroxyethylidene phosphonate | ChemIDplus |
| disodium dihydrogen (1-hydroxyethylidene)diphosphonate | ChemIDplus |
| Brand Name | Source |
|---|---|
| Didronel | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D00314 | KEGG DRUG |
| DB01077 | DrugBank |
| HMDB0015210 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5190835 | Reaxys |
| CAS:7414-83-7 | ChemIDplus |
| Citations |
|---|