EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N2S |
| Net Charge | 0 |
| Average Mass | 204.298 |
| Monoisotopic Mass | 204.07212 |
| SMILES | [H][C@@]1(c2ccccc2)CN2CCSC2=N1 |
| InChI | InChI=1S/C11H12N2S/c1-2-4-9(5-3-1)10-8-13-6-7-14-11(13)12-10/h1-5,10H,6-8H2/t10-/m0/s1 |
| InChIKey | HLFSDGLLUJUHTE-JTQLQIEISA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dexamisole (CHEBI:77282) has role antidepressant (CHEBI:35469) |
| dexamisole (CHEBI:77282) is a 6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (CHEBI:77278) |
| dexamisole (CHEBI:77282) is enantiomer of levamisole (CHEBI:6432) |
| Incoming Relation(s) |
| tetramisole (CHEBI:77289) has part dexamisole (CHEBI:77282) |
| levamisole (CHEBI:6432) is enantiomer of dexamisole (CHEBI:77282) |
| IUPAC Name |
|---|
| (6R)-6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| INNs | Source |
|---|---|
| dexamisol | WHO MedNet |
| dexamisole | WHO MedNet |
| dexamisole | WHO MedNet |
| dexamisolum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (+)-6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole | ChEBI |
| (+)-6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b]thiazole | ChEBI |
| (R)-(+)-tetramisole | ChemIDplus |
| (+)-tetramisole | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D03708 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5267119 | Reaxys |
| CAS:14769-74-5 | ChemIDplus |
| Citations |
|---|