EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N2S |
| Net Charge | 0 |
| Average Mass | 204.298 |
| Monoisotopic Mass | 204.07212 |
| SMILES | c1ccc(C2CN3CCSC3=N2)cc1 |
| InChI | InChI=1S/C11H12N2S/c1-2-4-9(5-3-1)10-8-13-6-7-14-11(13)12-10/h1-5,10H,6-8H2 |
| InChIKey | HLFSDGLLUJUHTE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (CHEBI:77278) has role environmental contaminant (CHEBI:78298) |
| 6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (CHEBI:77278) has role xenobiotic (CHEBI:35703) |
| 6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (CHEBI:77278) is a imidazothiazole (CHEBI:48909) |
| Incoming Relation(s) |
| dexamisole (CHEBI:77282) is a 6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (CHEBI:77278) |
| levamisole (CHEBI:6432) is a 6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (CHEBI:77278) |
| IUPAC Name |
|---|
| 6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| Manual Xrefs | Databases |
|---|---|
| LSM-1579 | LINCS |