EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N2S |
| Net Charge | 0 |
| Average Mass | 204.298 |
| Monoisotopic Mass | 204.07212 |
| SMILES | [H][C@]1(c2ccccc2)CN2CCSC2=N1 |
| InChI | InChI=1S/C11H12N2S/c1-2-4-9(5-3-1)10-8-13-6-7-14-11(13)12-10/h1-5,10H,6-8H2/t10-/m1/s1 |
| InChIKey | HLFSDGLLUJUHTE-SNVBAGLBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. immunological adjuvant A substance that augments, stimulates, activates, potentiates, or modulates the immune response at either the cellular or humoral level. A classical agent (Freund's adjuvant, BCG, Corynebacterium parvum, et al.) contains bacterial antigens. It could also be endogenous (e.g., histamine, interferon, transfer factor, tuftsin, interleukin-1). Its mode of action is either non-specific, resulting in increased immune responsiveness to a wide variety of antigens, or antigen-specific, i.e., affecting a restricted type of immune response to a narrow group of antigens. The therapeutic efficacy is related to its antigen-specific immunoadjuvanticity. EC 3.1.3.1 (alkaline phosphatase) inhibitor An EC 3.1.3.* (phosphoric monoester hydrolase) inhibitor that interferes with the action of alkaline phosphatase (EC 3.1.3.1). xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. immunological adjuvant A substance that augments, stimulates, activates, potentiates, or modulates the immune response at either the cellular or humoral level. A classical agent (Freund's adjuvant, BCG, Corynebacterium parvum, et al.) contains bacterial antigens. It could also be endogenous (e.g., histamine, interferon, transfer factor, tuftsin, interleukin-1). Its mode of action is either non-specific, resulting in increased immune responsiveness to a wide variety of antigens, or antigen-specific, i.e., affecting a restricted type of immune response to a narrow group of antigens. The therapeutic efficacy is related to its antigen-specific immunoadjuvanticity. antinematodal drug A substance used in the treatment or control of nematode infestations. antirheumatic drug A drug used to treat rheumatoid arthritis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| levamisole (CHEBI:6432) has role antinematodal drug (CHEBI:35444) |
| levamisole (CHEBI:6432) has role antirheumatic drug (CHEBI:35842) |
| levamisole (CHEBI:6432) has role EC 3.1.3.1 (alkaline phosphatase) inhibitor (CHEBI:63332) |
| levamisole (CHEBI:6432) has role immunological adjuvant (CHEBI:50847) |
| levamisole (CHEBI:6432) has role immunomodulator (CHEBI:50846) |
| levamisole (CHEBI:6432) is a 6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (CHEBI:77278) |
| levamisole (CHEBI:6432) is enantiomer of dexamisole (CHEBI:77282) |
| Incoming Relation(s) |
| tetramisole (CHEBI:77289) has part levamisole (CHEBI:6432) |
| dexamisole (CHEBI:77282) is enantiomer of levamisole (CHEBI:6432) |
| IUPAC Name |
|---|
| (6S)-6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| INNs | Source |
|---|---|
| levamisol | WHO MedNet |
| levamisole | WHO MedNet |
| lévamisole | WHO MedNet |
| levamisolum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (−)-6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole | ChEBI |
| (−)-6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b]thiazole | ChEBI |
| (S)-2,3,5,6-tetrahydro-6-phenylimidazo[2,1-b]thiazole | ChEBI |
| (S)-(−)-levamisole | ChemIDplus |
| (S)-(−)-tetramisole | ChEBI |
| (−)-tetramisole | ChemIDplus |
| Brand Names | Source |
|---|---|
| Ketrax | KEGG DRUG |
| Lepuron | ChemIDplus |
| Levomysol | ChemIDplus |
| Levovermax | ChEBI |
| Totalon | ChEBI |
| Wormicid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4233256 | Reaxys |
| CAS:14769-73-4 | KEGG COMPOUND |
| CAS:14769-73-4 | ChemIDplus |
| Citations |
|---|