EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H21Br2N2 |
| Net Charge | +1 |
| Average Mass | 377.144 |
| Monoisotopic Mass | 375.00660 |
| SMILES | C[NH+](Cc1cc(Br)cc(Br)c1N)C1CCCCC1 |
| InChI | InChI=1S/C14H20Br2N2/c1-18(12-5-3-2-4-6-12)9-10-7-11(15)8-13(16)14(10)17/h7-8,12H,2-6,9,17H2,1H3/p+1 |
| InChIKey | OJGDCBLYJGHCIH-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bromhexine(1+) (CHEBI:77040) is a ammonium ion derivative (CHEBI:35274) |
| bromhexine(1+) (CHEBI:77040) is conjugate acid of bromhexine (CHEBI:77032) |
| Incoming Relation(s) |
| bromhexine hydrochloride (CHEBI:31303) has part bromhexine(1+) (CHEBI:77040) |
| bromhexine (CHEBI:77032) is conjugate base of bromhexine(1+) (CHEBI:77040) |
| IUPAC Name |
|---|
| N-(2-amino-3,5-dibromobenzyl)-N-methylcyclohexanaminium |