EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:77032 - bromhexine
| Formula | C14H20Br2N2 |
| Net Charge | 0 |
| Average Mass | 376.136 |
| Monoisotopic Mass | 373.99932 |
| SMILES | CN(Cc1cc(Br)cc(Br)c1N)C1CCCCC1 |
| InChI | InChI=1S/C14H20Br2N2/c1-18(12-5-3-2-4-6-12)9-10-7-11(15)8-13(16)14(10)17/h7-8,12H,2-6,9,17H2,1H3 |
| InChIKey | OJGDCBLYJGHCIH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | mucolytic A compound that alters the structure of mucus so as to decrease its viscosity and thereby facilitate its removal by ciliary action and expectoration. Compare with antitussives, which suppress the cough reflex, and expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bromhexine (CHEBI:77032) has role mucolytic (CHEBI:77034) |
| bromhexine (CHEBI:77032) is a organobromine compound (CHEBI:37141) |
| bromhexine (CHEBI:77032) is a substituted aniline (CHEBI:48975) |
| bromhexine (CHEBI:77032) is a tertiary amino compound (CHEBI:50996) |
| bromhexine (CHEBI:77032) is conjugate base of bromhexine(1+) (CHEBI:77040) |
| Incoming Relation(s) |
| bromhexine(1+) (CHEBI:77040) is conjugate acid of bromhexine (CHEBI:77032) |
| IUPAC Name |
|---|
| 2,4-dibromo-6-{[cyclohexyl(methyl)amino]methyl}aniline |
| INNs | Source |
|---|---|
| bromhexine | WHO MedNet |
| bromhexinum | ChemIDplus |
| bromhexina | ChemIDplus |
| bromhexine | ChemIDplus |
| Synonyms | Source |
|---|---|
| N-cyclohexyl-N-methyl-(2-amino-3,5-dibrombenzyl)amine | ChemIDplus |
| 3,5-dibromo-Nα-cyclohexyl-Nα-methyltoluene-α-2-diamine | ChemIDplus |
| Brand Name | Source |
|---|---|
| Fluibron | KEGG DRUG |
| Citations |
|---|