EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20Br2N2.HCl |
| Net Charge | 0 |
| Average Mass | 412.597 |
| Monoisotopic Mass | 409.97600 |
| SMILES | CN(Cc1cc(Br)cc(Br)c1N)C1CCCCC1.Cl |
| InChI | InChI=1S/C14H20Br2N2.ClH/c1-18(12-5-3-2-4-6-12)9-10-7-11(15)8-13(16)14(10)17;/h7-8,12H,2-6,9,17H2,1H3;1H |
| InChIKey | UCDKONUHZNTQPY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | mucolytic A compound that alters the structure of mucus so as to decrease its viscosity and thereby facilitate its removal by ciliary action and expectoration. Compare with antitussives, which suppress the cough reflex, and expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bromhexine hydrochloride (CHEBI:31303) has part bromhexine(1+) (CHEBI:77040) |
| bromhexine hydrochloride (CHEBI:31303) has role mucolytic (CHEBI:77034) |
| bromhexine hydrochloride (CHEBI:31303) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 2,4-dibromo-6-{[cyclohexyl(methyl)amino]methyl}aniline hydrochloride |
| Synonyms | Source |
|---|---|
| 2-amino-N-cyclohexyl-3,5-dibromo-N-methylbenzylamine hydrochloride | ChemIDplus |
| 3,5-dibromo-Nα-cyclohexyl-Nα-methyltoluene-α,2-diamine monohydrochloride | ChemIDplus |
| bromhexine chloride | ChemIDplus |
| bromhexine HCl | ChemIDplus |
| bromohexine monohydrochloride | ChemIDplus |
| N-(2-amino-3,5-dibromobenzyl)-N-methylcyclohexanaminium chloride | IUPAC |
| Brand Names | Source |
|---|---|
| Auxit | ChemIDplus |
| Broncokin | ChemIDplus |
| Ophtolsol | ChEBI |
| Quentan | ChEBI |
| Viscolyt | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1786 | VSDB |
| CN101817754 | Patent |
| D01778 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4848376 | Reaxys |
| CAS:611-75-6 | ChemIDplus |
| Citations |
|---|