EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20Br2N6O4S |
| Net Charge | 0 |
| Average Mass | 588.282 |
| Monoisotopic Mass | 585.96335 |
| SMILES | CCCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H20Br2N6O4S/c1-2-7-26-32(28,29)27-17-16(13-3-5-14(20)6-4-13)18(25-12-24-17)30-8-9-31-19-22-10-15(21)11-23-19/h3-6,10-12,26H,2,7-9H2,1H3,(H,24,25,27) |
| InChIKey | JGCMEBMXRHSZKX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | endothelin receptor antagonist A hormone antagonist that blocks endothelin receptors. |
| Applications: | orphan drug Any drug that has been developed specifically for treatment of a rare medical condition, the condition itself being known as an orphan disease. endothelin receptor antagonist A hormone antagonist that blocks endothelin receptors. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| macitentan (CHEBI:76607) has functional parent ACT-132577 (CHEBI:76609) |
| macitentan (CHEBI:76607) has functional parent ethylene glycol (CHEBI:30742) |
| macitentan (CHEBI:76607) has role antihypertensive agent (CHEBI:35674) |
| macitentan (CHEBI:76607) has role endothelin receptor antagonist (CHEBI:51451) |
| macitentan (CHEBI:76607) has role orphan drug (CHEBI:71031) |
| macitentan (CHEBI:76607) is a aromatic ether (CHEBI:35618) |
| macitentan (CHEBI:76607) is a organobromine compound (CHEBI:37141) |
| macitentan (CHEBI:76607) is a pyrimidines (CHEBI:39447) |
| macitentan (CHEBI:76607) is a ring assembly (CHEBI:36820) |
| macitentan (CHEBI:76607) is a sulfamides (CHEBI:51871) |
| IUPAC Name |
|---|
| N-[5-(4-bromophenyl)-6-{2-[(5-bromopyrimidin-2-yl)oxy]ethoxy}pyrimidin-4-yl]-N'-propylsulfuric diamide |
| INNs | Source |
|---|---|
| macitentan | ChemIDplus |
| macitentan | WHO MedNet |
| macitentán | WHO MedNet |
| macitentanum | WHO MedNet |
| Synonyms | Source |
|---|---|
| ACT 064992 | ChemIDplus |
| ACT-064992 | ChemIDplus |
| ACT064992 | ChemIDplus |
| Brand Name | Source |
|---|---|
| OPSUMIT | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 4809 | DrugCentral |
| D10135 | KEGG DRUG |
| Macitentan | Wikipedia |
| US2008233188 | Patent |
| WO2007119214 | Patent |
| WO2008026156 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11340634 | Reaxys |
| CAS:441798-33-0 | ChemIDplus |
| CAS:441798-33-0 | KEGG DRUG |
| Citations |
|---|