EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20Br2N6O4S |
| Net Charge | 0 |
| Average Mass | 588.282 |
| Monoisotopic Mass | 585.96335 |
| SMILES | CCCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H20Br2N6O4S/c1-2-7-26-32(28,29)27-17-16(13-3-5-14(20)6-4-13)18(25-12-24-17)30-8-9-31-19-22-10-15(21)11-23-19/h3-6,10-12,26H,2,7-9H2,1H3,(H,24,25,27) |
| InChIKey | JGCMEBMXRHSZKX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | endothelin receptor antagonist A hormone antagonist that blocks endothelin receptors. |
| Applications: | orphan drug Any drug that has been developed specifically for treatment of a rare medical condition, the condition itself being known as an orphan disease. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. endothelin receptor antagonist A hormone antagonist that blocks endothelin receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| macitentan (CHEBI:76607) has functional parent ACT-132577 (CHEBI:76609) |
| macitentan (CHEBI:76607) has functional parent ethylene glycol (CHEBI:30742) |
| macitentan (CHEBI:76607) has role antihypertensive agent (CHEBI:35674) |
| macitentan (CHEBI:76607) has role endothelin receptor antagonist (CHEBI:51451) |
| macitentan (CHEBI:76607) has role orphan drug (CHEBI:71031) |
| macitentan (CHEBI:76607) is a aromatic ether (CHEBI:35618) |
| macitentan (CHEBI:76607) is a organobromine compound (CHEBI:37141) |
| macitentan (CHEBI:76607) is a pyrimidines (CHEBI:39447) |
| macitentan (CHEBI:76607) is a ring assembly (CHEBI:36820) |
| macitentan (CHEBI:76607) is a sulfamides (CHEBI:51871) |
| IUPAC Name |
|---|
| N-[5-(4-bromophenyl)-6-{2-[(5-bromopyrimidin-2-yl)oxy]ethoxy}pyrimidin-4-yl]-N'-propylsulfuric diamide |
| INNs | Source |
|---|---|
| macitentan | ChemIDplus |
| macitentan | WHO MedNet |
| macitentán | WHO MedNet |
| macitentanum | WHO MedNet |
| Synonyms | Source |
|---|---|
| ACT 064992 | ChemIDplus |
| ACT-064992 | ChemIDplus |
| ACT064992 | ChemIDplus |
| Brand Name | Source |
|---|---|
| OPSUMIT | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 4809 | DrugCentral |
| D10135 | KEGG DRUG |
| Macitentan | Wikipedia |
| US2008233188 | Patent |
| WO2007119214 | Patent |
| WO2008026156 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11340634 | Reaxys |
| CAS:441798-33-0 | ChemIDplus |
| CAS:441798-33-0 | KEGG DRUG |
| Citations |
|---|