EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14Br2N6O4S |
| Net Charge | 0 |
| Average Mass | 546.201 |
| Monoisotopic Mass | 543.91640 |
| SMILES | NS(=O)(=O)Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H14Br2N6O4S/c17-11-3-1-10(2-4-11)13-14(24-29(19,25)26)22-9-23-15(13)27-5-6-28-16-20-7-12(18)8-21-16/h1-4,7-9H,5-6H2,(H2,19,25,26)(H,22,23,24) |
| InChIKey | DKULOVKANLVDEA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | endothelin receptor antagonist A hormone antagonist that blocks endothelin receptors. xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. |
| Applications: | endothelin receptor antagonist A hormone antagonist that blocks endothelin receptors. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ACT-132577 (CHEBI:76609) has functional parent ethylene glycol (CHEBI:30742) |
| ACT-132577 (CHEBI:76609) has role antihypertensive agent (CHEBI:35674) |
| ACT-132577 (CHEBI:76609) has role drug metabolite (CHEBI:49103) |
| ACT-132577 (CHEBI:76609) has role endothelin receptor antagonist (CHEBI:51451) |
| ACT-132577 (CHEBI:76609) has role renoprotective agent (CHEBI:231911) |
| ACT-132577 (CHEBI:76609) has role xenobiotic metabolite (CHEBI:76206) |
| ACT-132577 (CHEBI:76609) is a aromatic ether (CHEBI:35618) |
| ACT-132577 (CHEBI:76609) is a organobromine compound (CHEBI:37141) |
| ACT-132577 (CHEBI:76609) is a pyrimidines (CHEBI:39447) |
| ACT-132577 (CHEBI:76609) is a sulfamides (CHEBI:51871) |
| Incoming Relation(s) |
| macitentan (CHEBI:76607) has functional parent ACT-132577 (CHEBI:76609) |
| IUPAC Name |
|---|
| N-[5-(4-bromophenyl)-6-{2-[(5-bromopyrimidin-2-yl)oxy]ethoxy}pyrimidin-4-yl]sulfuric diamide |
| Synonyms | Source |
|---|---|
| ACT-132577 | ChEMBL |
| aprocitentan | ChEMBL |
| Aprocitentan | ChEMBL |
| Macitentan metabolite m6 | ChEMBL |
| Tryvio | ChEMBL |
| Brand Name | Source |
|---|---|
| Jeraygo | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| US2008233188 | Patent |
| WO2007119214 | Patent |
| WO2008026156 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11340634 | Reaxys |
| Citations |
|---|