EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:76258 - oxyphenbutazone
| Formula | C19H20N2O3 |
| Net Charge | 0 |
| Average Mass | 324.380 |
| Monoisotopic Mass | 324.14739 |
| SMILES | CCCCC1C(=O)N(c2ccccc2)N(c2ccc(O)cc2)C1=O |
| InChI | InChI=1S/C19H20N2O3/c1-2-3-9-17-18(23)20(14-7-5-4-6-8-14)21(19(17)24)15-10-12-16(22)13-11-15/h4-8,10-13,17,22H,2-3,9H2,1H3 |
| InChIKey | HFHZKZSRXITVMK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. gout suppressant A drug that increases uric acid excretion by the kidney (uricosuric drug), decreases uric acid production (antihyperuricemic), or alleviates the pain and inflammation of acute attacks of gout. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxyphenbutazone (CHEBI:76258) has functional parent phenylbutazone (CHEBI:48574) |
| oxyphenbutazone (CHEBI:76258) has role antimicrobial agent (CHEBI:33281) |
| oxyphenbutazone (CHEBI:76258) has role antineoplastic agent (CHEBI:35610) |
| oxyphenbutazone (CHEBI:76258) has role antipyretic (CHEBI:35493) |
| oxyphenbutazone (CHEBI:76258) has role drug metabolite (CHEBI:49103) |
| oxyphenbutazone (CHEBI:76258) has role gout suppressant (CHEBI:35845) |
| oxyphenbutazone (CHEBI:76258) has role non-narcotic analgesic (CHEBI:35481) |
| oxyphenbutazone (CHEBI:76258) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| oxyphenbutazone (CHEBI:76258) has role ophthalmology drug (CHEBI:66981) |
| oxyphenbutazone (CHEBI:76258) has role xenobiotic metabolite (CHEBI:76206) |
| oxyphenbutazone (CHEBI:76258) is a phenols (CHEBI:33853) |
| oxyphenbutazone (CHEBI:76258) is a pyrazolidines (CHEBI:38312) |
| Incoming Relation(s) |
| oxyphenbutazone hydrate (CHEBI:76259) has part oxyphenbutazone (CHEBI:76258) |
| INNs | Source |
|---|---|
| oxifenbutazona | ChemIDplus |
| oxyphenbutazone | WHO MedNet |
| oxyphenbutazone | KEGG DRUG |
| oxyphenbutazonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-Phenyl-2-(p-hydroxyphenyl)-3,5-dioxo-4-butylpyrazolidine | NIST Chemistry WebBook |
| 1-Phenyl-2-(p-hydroxyphenyl)-3,5-dioxo-4-n-butylpyrazolidine | NIST Chemistry WebBook |
| 1-(p-Hydroxyphenyl)-2-phenyl-4-butyl-3,5-pyrazolidinedione | DrugBank |
| 3,5-Dioxo-1-phenyl-2-(p-hydroxyphenyl)-4-N-butylpyrazolidene | ChemIDplus |
| 4-Butyl-1-(4-hydroxyphenyl)-2-phenyl-3,5-pyrazolidinedione | DrugBank |
| 4-Butyl-1-(p-hydroxyphenyl)-2-phenyl-3,5-pyrazolidinedione | DrugBank |
| Brand Names | Source |
|---|---|
| Tanderil | ChEMBL |
| Tanderil chloramphen | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2036 | DrugCentral |
| C19494 | KEGG COMPOUND |
| D08324 | KEGG DRUG |
| DB03585 | DrugBank |
| EP642336 | Patent |
| LSM-5029 | LINCS |
| Oxyphenbutazone | Wikipedia |
| US2008014272 | Patent |
| WO2005107748 | Patent |
| Citations |
|---|