EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20N2O3 |
| Net Charge | 0 |
| Average Mass | 324.380 |
| Monoisotopic Mass | 324.14739 |
| SMILES | CCCCC1C(=O)N(c2ccccc2)N(c2ccc(O)cc2)C1=O |
| InChI | InChI=1S/C19H20N2O3/c1-2-3-9-17-18(23)20(14-7-5-4-6-8-14)21(19(17)24)15-10-12-16(22)13-11-15/h4-8,10-13,17,22H,2-3,9H2,1H3 |
| InChIKey | HFHZKZSRXITVMK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. gout suppressant A drug that increases uric acid excretion by the kidney (uricosuric drug), decreases uric acid production (antihyperuricemic), or alleviates the pain and inflammation of acute attacks of gout. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxyphenbutazone (CHEBI:76258) has functional parent phenylbutazone (CHEBI:48574) |
| oxyphenbutazone (CHEBI:76258) has role antimicrobial agent (CHEBI:33281) |
| oxyphenbutazone (CHEBI:76258) has role antineoplastic agent (CHEBI:35610) |
| oxyphenbutazone (CHEBI:76258) has role antipyretic (CHEBI:35493) |
| oxyphenbutazone (CHEBI:76258) has role drug metabolite (CHEBI:49103) |
| oxyphenbutazone (CHEBI:76258) has role gout suppressant (CHEBI:35845) |
| oxyphenbutazone (CHEBI:76258) has role non-narcotic analgesic (CHEBI:35481) |
| oxyphenbutazone (CHEBI:76258) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| oxyphenbutazone (CHEBI:76258) has role ophthalmology drug (CHEBI:66981) |
| oxyphenbutazone (CHEBI:76258) has role xenobiotic metabolite (CHEBI:76206) |
| oxyphenbutazone (CHEBI:76258) is a phenols (CHEBI:33853) |
| oxyphenbutazone (CHEBI:76258) is a pyrazolidines (CHEBI:38312) |
| Incoming Relation(s) |
| oxyphenbutazone hydrate (CHEBI:76259) has part oxyphenbutazone (CHEBI:76258) |
| INNs | Source |
|---|---|
| oxifenbutazona | ChemIDplus |
| oxyphenbutazone | WHO MedNet |
| oxyphenbutazone | KEGG DRUG |
| oxyphenbutazonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-Phenyl-2-(p-hydroxyphenyl)-3,5-dioxo-4-butylpyrazolidine | NIST Chemistry WebBook |
| 1-Phenyl-2-(p-hydroxyphenyl)-3,5-dioxo-4-n-butylpyrazolidine | NIST Chemistry WebBook |
| 1-(p-Hydroxyphenyl)-2-phenyl-4-butyl-3,5-pyrazolidinedione | DrugBank |
| 3,5-Dioxo-1-phenyl-2-(p-hydroxyphenyl)-4-N-butylpyrazolidene | ChemIDplus |
| 4-Butyl-1-(4-hydroxyphenyl)-2-phenyl-3,5-pyrazolidinedione | DrugBank |
| 4-Butyl-1-(p-hydroxyphenyl)-2-phenyl-3,5-pyrazolidinedione | DrugBank |
| Brand Names | Source |
|---|---|
| Tanderil | ChEMBL |
| Tanderil chloramphen | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2036 | DrugCentral |
| C19494 | KEGG COMPOUND |
| D08324 | KEGG DRUG |
| DB03585 | DrugBank |
| EP642336 | Patent |
| LSM-5029 | LINCS |
| Oxyphenbutazone | Wikipedia |
| US2008014272 | Patent |
| WO2005107748 | Patent |
| Citations |
|---|