EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20N2O2 |
| Net Charge | 0 |
| Average Mass | 308.381 |
| Monoisotopic Mass | 308.15248 |
| SMILES | CCCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C19H20N2O2/c1-2-3-14-17-18(22)20(15-10-6-4-7-11-15)21(19(17)23)16-12-8-5-9-13-16/h4-13,17H,2-3,14H2,1H3 |
| InChIKey | VYMDGNCVAMGZFE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.1.1.184 [carbonyl reductase (NADPH)] inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that interferes with the action of carbonyl reductase (NADPH), EC 1.1.1.184. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. antirheumatic drug A drug used to treat rheumatoid arthritis. peripheral nervous system drug A drug that acts principally at one or more sites within the peripheral neuroeffector systems, the autonomic system, and motor nerve-skeletal system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenylbutazone (CHEBI:48574) has role antirheumatic drug (CHEBI:35842) |
| phenylbutazone (CHEBI:48574) has role EC 1.1.1.184 [carbonyl reductase (NADPH)] inhibitor (CHEBI:73136) |
| phenylbutazone (CHEBI:48574) has role metabolite (CHEBI:25212) |
| phenylbutazone (CHEBI:48574) has role non-narcotic analgesic (CHEBI:35481) |
| phenylbutazone (CHEBI:48574) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| phenylbutazone (CHEBI:48574) has role peripheral nervous system drug (CHEBI:49110) |
| phenylbutazone (CHEBI:48574) is a pyrazolidines (CHEBI:38312) |
| Incoming Relation(s) |
| kebuzone (CHEBI:31749) has functional parent phenylbutazone (CHEBI:48574) |
| oxyphenbutazone (CHEBI:76258) has functional parent phenylbutazone (CHEBI:48574) |
| IUPAC Name |
|---|
| 4-butyl-1,2-diphenylpyrazolidine-3,5-dione |
| INNs | Source |
|---|---|
| fenilbutazona | ChemIDplus |
| phenylbutazone | ChemIDplus |
| phénylbutazone | WHO MedNet |
| phenylbutazonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3,5-Dioxo-1,2-diphenyl-4-n-butylpyrazolidine | ChemIDplus |
| 4-BUTYL-1,2-DIPHENYL-PYRAZOLIDINE-3,5-DIONE | PDBeChem |
| 4-n-Butyl-1,2-diphenyl-3,5-pyrazolidinedione | ChemIDplus |
| Ambene | ChEMBL |
| Artrizin | ChEMBL |
| Bizolin | ChEMBL |
| Brand Names | Source |
|---|---|
| Antadol | ChEMBL |
| Azolid | ChEMBL |
| Butacote | ChEMBL |
| Butaject | ChEMBL |
| Butazolidin | ChEMBL |
| Elmedal | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1775 | VSDB |
| 2145 | DrugCentral |
| C07440 | KEGG COMPOUND |
| D00510 | KEGG DRUG |
| DB00812 | DrugBank |
| HMDB0014950 | HMDB |
| LSM-2219 | LINCS |
| P1Z | PDBeChem |
| Phenylbutazone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:290080 | Reaxys |
| CAS:50-33-9 | KEGG COMPOUND |
| Citations |
|---|