EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:48574 - phenylbutazone
| Formula | C19H20N2O2 |
| Net Charge | 0 |
| Average Mass | 308.381 |
| Monoisotopic Mass | 308.15248 |
| SMILES | CCCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C19H20N2O2/c1-2-3-14-17-18(22)20(15-10-6-4-7-11-15)21(19(17)23)16-12-8-5-9-13-16/h4-13,17H,2-3,14H2,1H3 |
| InChIKey | VYMDGNCVAMGZFE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.1.1.184 [carbonyl reductase (NADPH)] inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that interferes with the action of carbonyl reductase (NADPH), EC 1.1.1.184. |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. peripheral nervous system drug A drug that acts principally at one or more sites within the peripheral neuroeffector systems, the autonomic system, and motor nerve-skeletal system. antirheumatic drug A drug used to treat rheumatoid arthritis. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenylbutazone (CHEBI:48574) has role antirheumatic drug (CHEBI:35842) |
| phenylbutazone (CHEBI:48574) has role EC 1.1.1.184 [carbonyl reductase (NADPH)] inhibitor (CHEBI:73136) |
| phenylbutazone (CHEBI:48574) has role metabolite (CHEBI:25212) |
| phenylbutazone (CHEBI:48574) has role non-narcotic analgesic (CHEBI:35481) |
| phenylbutazone (CHEBI:48574) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| phenylbutazone (CHEBI:48574) has role peripheral nervous system drug (CHEBI:49110) |
| phenylbutazone (CHEBI:48574) is a pyrazolidines (CHEBI:38312) |
| Incoming Relation(s) |
| kebuzone (CHEBI:31749) has functional parent phenylbutazone (CHEBI:48574) |
| oxyphenbutazone (CHEBI:76258) has functional parent phenylbutazone (CHEBI:48574) |
| IUPAC Name |
|---|
| 4-butyl-1,2-diphenylpyrazolidine-3,5-dione |
| INNs | Source |
|---|---|
| fenilbutazona | ChemIDplus |
| phenylbutazone | ChemIDplus |
| phénylbutazone | WHO MedNet |
| phenylbutazonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3,5-Dioxo-1,2-diphenyl-4-n-butylpyrazolidine | ChemIDplus |
| 4-BUTYL-1,2-DIPHENYL-PYRAZOLIDINE-3,5-DIONE | PDBeChem |
| 4-n-Butyl-1,2-diphenyl-3,5-pyrazolidinedione | ChemIDplus |
| Phenbutazone | KEGG COMPOUND |
| Phenylbutazon | ChemIDplus |
| Phenylbutazone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 1775 | VSDB |
| 2145 | DrugCentral |
| C07440 | KEGG COMPOUND |
| D00510 | KEGG DRUG |
| DB00812 | DrugBank |
| HMDB0014950 | HMDB |
| LSM-2219 | LINCS |
| P1Z | PDBeChem |
| Phenylbutazone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:290080 | Reaxys |
| CAS:50-33-9 | KEGG COMPOUND |
| Citations |
|---|