EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20N2O3.H2O |
| Net Charge | 0 |
| Average Mass | 342.395 |
| Monoisotopic Mass | 342.15796 |
| SMILES | CCCCC1C(=O)N(c2ccccc2)N(c2ccc(O)cc2)C1=O.O |
| InChI | InChI=1S/C19H20N2O3.H2O/c1-2-3-9-17-18(23)20(14-7-5-4-6-8-14)21(19(17)24)15-10-12-16(22)13-11-15;/h4-8,10-13,17,22H,2-3,9H2,1H3;1H2 |
| InChIKey | CNDQSXOVEQXJOE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. gout suppressant A drug that increases uric acid excretion by the kidney (uricosuric drug), decreases uric acid production (antihyperuricemic), or alleviates the pain and inflammation of acute attacks of gout. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxyphenbutazone hydrate (CHEBI:76259) has part oxyphenbutazone (CHEBI:76258) |
| oxyphenbutazone hydrate (CHEBI:76259) has role antimicrobial agent (CHEBI:33281) |
| oxyphenbutazone hydrate (CHEBI:76259) has role antineoplastic agent (CHEBI:35610) |
| oxyphenbutazone hydrate (CHEBI:76259) has role antipyretic (CHEBI:35493) |
| oxyphenbutazone hydrate (CHEBI:76259) has role gout suppressant (CHEBI:35845) |
| oxyphenbutazone hydrate (CHEBI:76259) has role non-narcotic analgesic (CHEBI:35481) |
| oxyphenbutazone hydrate (CHEBI:76259) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| oxyphenbutazone hydrate (CHEBI:76259) is a hydrate (CHEBI:35505) |
| IUPAC Name |
|---|
| 4-butyl-1-(4-hydroxyphenyl)-2-phenylpyrazolidine-3,5-dione—water (1/1) |
| Synonyms | Source |
|---|---|
| 4-butyl-1-(4-hydroxyphenyl)-2-phenylpyrazolidine-3,5-dione hydrate | ChEBI |
| 4-Butyl-1-(p-hydroxyphenyl)-2-phenyl-3,5-pyrazolidinedione monohydrate | ChemIDplus |
| Oxyphenbutazone | ChemIDplus |
| oxyphenbutazone monohydrate | ChEBI |
| Brand Name | Source |
|---|---|
| Tandearil | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| D05319 | KEGG DRUG |
| Oxyphenbutazone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5786228 | Reaxys |
| CAS:7081-38-1 | ChemIDplus |
| CAS:7081-38-1 | KEGG DRUG |