EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H10ClN2O2 |
| Net Charge | -1 |
| Average Mass | 261.688 |
| Monoisotopic Mass | 261.04363 |
| SMILES | Cc1c(Cl)cccc1Nc1ncccc1C(=O)[O-] |
| InChI | InChI=1S/C13H11ClN2O2/c1-8-10(14)5-2-6-11(8)16-12-9(13(17)18)4-3-7-15-12/h2-7H,1H3,(H,15,16)(H,17,18)/p-1 |
| InChIKey | CLOMYZFHNHFSIQ-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clonixin(1−) (CHEBI:76203) is a monocarboxylic acid anion (CHEBI:35757) |
| clonixin(1−) (CHEBI:76203) is conjugate base of clonixin (CHEBI:76200) |
| Incoming Relation(s) |
| clonixin lysine salt (CHEBI:76201) has part clonixin(1−) (CHEBI:76203) |
| clonixin (CHEBI:76200) is conjugate acid of clonixin(1−) (CHEBI:76203) |
| IUPAC Name |
|---|
| 2-[(3-chloro-2-methylphenyl)amino]nicotinate |
| Synonym | Source |
|---|---|
| clonixin anion | ChEBI |