EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H11ClN2O2.C6H14N2O2 |
| Net Charge | 0 |
| Average Mass | 408.886 |
| Monoisotopic Mass | 408.15643 |
| SMILES | Cc1c(Cl)cccc1Nc1ncccc1C(=O)O.NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C13H11ClN2O2.C6H14N2O2/c1-8-10(14)5-2-6-11(8)16-12-9(13(17)18)4-3-7-15-12;7-4-2-1-3-5(8)6(9)10/h2-7H,1H3,(H,15,16)(H,17,18);5H,1-4,7-8H2,(H,9,10)/t;5-/m.0/s1 |
| InChIKey | CVNFYQCHAWFYQI-ZSCHJXSPSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. lipoxygenase inhibitor A compound or agent that combines with lipoxygenase and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of the icosanoid products hydroxyicosatetraenoic acid and various leukotrienes. EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. |
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clonixin lysine salt (CHEBI:76201) has part L-lysinium(1+) (CHEBI:32551) |
| clonixin lysine salt (CHEBI:76201) has part clonixin(1−) (CHEBI:76203) |
| clonixin lysine salt (CHEBI:76201) has role antipyretic (CHEBI:35493) |
| clonixin lysine salt (CHEBI:76201) has role EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor (CHEBI:35544) |
| clonixin lysine salt (CHEBI:76201) has role lipoxygenase inhibitor (CHEBI:35856) |
| clonixin lysine salt (CHEBI:76201) has role non-narcotic analgesic (CHEBI:35481) |
| clonixin lysine salt (CHEBI:76201) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| clonixin lysine salt (CHEBI:76201) has role platelet aggregation inhibitor (CHEBI:50427) |
| clonixin lysine salt (CHEBI:76201) has role vasodilator agent (CHEBI:35620) |
| clonixin lysine salt (CHEBI:76201) is a organoammonium salt (CHEBI:46850) |
| IUPAC Names |
|---|
| 2-[(3-chloro-2-methylphenyl)amino]nicotinic acid—L-lysine (1/1) |
| (2S)-2,6-diazaniumylhexanoate 2-[(3-chloro-2-methylphenyl)amino]nicotinate |
| Synonyms | Source |
|---|---|
| 2-(2'-Methyl-3'-chloroanilino)lysine nicotinate | ChemIDplus |
| L 104 | ChemIDplus |
| L-Lysine, mono(2-((3-chloro-2-methylphenyl)amino)-3-pyridinecarboxylate) | ChemIDplus |
| Lysine clonixinate | ChemIDplus |
| L-clonixin lysine salt | ChEBI |
| L-lysine clonixinate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7242905 | Reaxys |
| CAS:55837-30-4 | ChemIDplus |
| CAS:55837-30-4 | KEGG DRUG |
| Citations |
|---|