EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18O10 |
| Net Charge | 0 |
| Average Mass | 442.376 |
| Monoisotopic Mass | 442.09000 |
| SMILES | O=C(O[C@H]1Cc2c(O)cc(O)cc2O[C@H]1c1ccc(O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C22H18O10/c23-11-6-14(25)12-8-19(32-22(30)10-4-16(27)20(29)17(28)5-10)21(31-18(12)7-11)9-1-2-13(24)15(26)3-9/h1-7,19,21,23-29H,8H2/t19-,21-/m0/s1 |
| InChIKey | LSHVYAFMTMFKBA-FPOVZHCZSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-epicatechin-3-O-gallate (CHEBI:76126) has functional parent (+)-epicatechin (CHEBI:76125) |
| (+)-epicatechin-3-O-gallate (CHEBI:76126) has functional parent gallic acid (CHEBI:30778) |
| (+)-epicatechin-3-O-gallate (CHEBI:76126) has role metabolite (CHEBI:25212) |
| (+)-epicatechin-3-O-gallate (CHEBI:76126) is a catechin (CHEBI:23053) |
| (+)-epicatechin-3-O-gallate (CHEBI:76126) is a gallate ester (CHEBI:37576) |
| (+)-epicatechin-3-O-gallate (CHEBI:76126) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (2S,3S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl 3,4,5-trihydroxybenzoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6773335 | Reaxys |
| CAS:863-03-6 | ChemIDplus |