EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O6 |
| Net Charge | 0 |
| Average Mass | 290.271 |
| Monoisotopic Mass | 290.07904 |
| SMILES | Oc1cc(O)c2c(c1)O[C@@H](c1ccc(O)c(O)c1)[C@@H](O)C2 |
| InChI | InChI=1S/C15H14O6/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7/h1-5,13,15-20H,6H2/t13-,15-/m0/s1 |
| InChIKey | PFTAWBLQPZVEMU-ZFWWWQNUSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. cyclooxygenase 1 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 1. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-epicatechin (CHEBI:76125) has role cyclooxygenase 1 inhibitor (CHEBI:50630) |
| (+)-epicatechin (CHEBI:76125) has role plant metabolite (CHEBI:76924) |
| (+)-epicatechin (CHEBI:76125) is a catechin (CHEBI:23053) |
| (+)-epicatechin (CHEBI:76125) is a polyphenol (CHEBI:26195) |
| (+)-epicatechin (CHEBI:76125) is enantiomer of (−)-epicatechin (CHEBI:90) |
| Incoming Relation(s) |
| (+)-epicatechin-3-O-gallate (CHEBI:76126) has functional parent (+)-epicatechin (CHEBI:76125) |
| (−)-epicatechin (CHEBI:90) is enantiomer of (+)-epicatechin (CHEBI:76125) |
| IUPAC Name |
|---|
| (2S,3S)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
| Synonyms | Source |
|---|---|
| (2S,3S)-3,3',4',5,7-pentahydroxyflavan | ChEBI |
| (2S,3S)-3',4',5,7-tetrahydroxyflavan-3-ol | ChEBI |
| ent-Epicatechin | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3655328 | Reaxys |
| CAS:35323-91-2 | KEGG COMPOUND |
| CAS:35323-91-2 | ChemIDplus |
| Citations |
|---|