EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21N2O3 |
| Net Charge | -1 |
| Average Mass | 325.388 |
| Monoisotopic Mass | 325.15577 |
| SMILES | CCCCC(C(=O)[O-])C(=O)N(Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H22N2O3/c1-2-3-14-17(19(23)24)18(22)21(16-12-8-5-9-13-16)20-15-10-6-4-7-11-15/h4-13,17,20H,2-3,14H2,1H3,(H,23,24)/p-1 |
| InChIKey | FLWFHHFTIRLFPV-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bumadizone(1−) (CHEBI:76124) is a monocarboxylic acid anion (CHEBI:35757) |
| bumadizone(1−) (CHEBI:76124) is conjugate base of bumadizone (CHEBI:76119) |
| Incoming Relation(s) |
| bumadizone calcium (CHEBI:76123) has part bumadizone(1−) (CHEBI:76124) |
| bumadizone (CHEBI:76119) is conjugate acid of bumadizone(1−) (CHEBI:76124) |
| IUPAC Name |
|---|
| 2-[(1,2-diphenylhydrazino)carbonyl]hexanoate |
| Synonym | Source |
|---|---|
| bumadizone anion | ChEBI |