EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C19H21N2O3.Ca |
| Net Charge | 0 |
| Average Mass | 690.854 |
| Monoisotopic Mass | 690.27303 |
| SMILES | CCCCC(C(=O)[O-])C(=O)N(Nc1ccccc1)c1ccccc1.CCCCC(C(=O)[O-])C(=O)N(Nc1ccccc1)c1ccccc1.[Ca+2] |
| InChI | InChI=1S/2C19H22N2O3.Ca/c2*1-2-3-14-17(19(23)24)18(22)21(16-12-8-5-9-13-16)20-15-10-6-4-7-11-15;/h2*4-13,17,20H,2-3,14H2,1H3,(H,23,24);/q;;+2/p-2 |
| InChIKey | RKINNRASCJRSHD-UHFFFAOYSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bumadizone calcium (CHEBI:76123) has part bumadizone(1−) (CHEBI:76124) |
| bumadizone calcium (CHEBI:76123) has role antipyretic (CHEBI:35493) |
| bumadizone calcium (CHEBI:76123) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| bumadizone calcium (CHEBI:76123) is a organic calcium salt (CHEBI:51031) |
| Incoming Relation(s) |
| bumadizone calcium hemihydrate (CHEBI:76122) has part bumadizone calcium (CHEBI:76123) |
| IUPAC Name |
|---|
| calcium bis{2-[(1,2-diphenylhydrazino)carbonyl]hexanoate} |
| Synonyms | Source |
|---|---|
| bumadizone calcium salt | ChEBI |
| Butylmalonic acid mono(1,2-diphenylhydrazide) calcium | ChemIDplus |
| Calcium-N-n-butylmalonic acid N,N'-diphenylhydrazide | ChemIDplus |
| anhydrous bumadizone calcium | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Bumadizone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:34461-73-9 | ChemIDplus |
| Citations |
|---|