EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O4 |
| Net Charge | 0 |
| Average Mass | 194.186 |
| Monoisotopic Mass | 194.05791 |
| SMILES | COc1cc(/C=C\C(=O)O)ccc1O |
| InChI | InChI=1S/C10H10O4/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13/h2-6,11H,1H3,(H,12,13)/b5-3- |
| InChIKey | KSEBMYQBYZTDHS-HYXAFXHYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-ferulic acid (CHEBI:76117) has functional parent cis-cinnamic acid (CHEBI:35699) |
| cis-ferulic acid (CHEBI:76117) has role plant metabolite (CHEBI:76924) |
| cis-ferulic acid (CHEBI:76117) has role platelet aggregation inhibitor (CHEBI:50427) |
| cis-ferulic acid (CHEBI:76117) is a ferulic acid (CHEBI:193350) |
| Incoming Relation(s) |
| (Z)-4-hydroxy-3-methoxycinnamoylagmatine (CHEBI:86093) has functional parent cis-ferulic acid (CHEBI:76117) |
| (2R,3R)-cis-fertaric acid (CHEBI:76115) has functional parent cis-ferulic acid (CHEBI:76117) |
| (2S,3S)-cis-fertaric acid (CHEBI:76118) has functional parent cis-ferulic acid (CHEBI:76117) |
| IUPAC Name |
|---|
| (2Z)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid |
| Synonyms | Source |
|---|---|
| (2Z)-3-(4-hydroxy-3-methoxyphenyl)-2-propenoic acid | ChEBI |
| cis-4-hydroxy-3-methoxycinnamic acid | ChEBI |
| (Z)-ferulic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00058916 | KNApSAcK |
| FDB021752 | FooDB |
| HMDB0240705 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2212757 | Reaxys |
| CAS:1014-83-1 | ChemIDplus |
| Citations |
|---|