EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:35699 - cis-cinnamic acid
| Formula | C9H8O2 |
| Net Charge | 0 |
| Average Mass | 148.161 |
| Monoisotopic Mass | 148.05243 |
| SMILES | O=C(O)/C=C\c1ccccc1 |
| InChI | InChI=1S/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11)/b7-6- |
| InChIKey | WBYWAXJHAXSJNI-SREVYHEPSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-cinnamic acid (CHEBI:35699) is a cinnamic acid (CHEBI:27386) |
| cis-cinnamic acid (CHEBI:35699) is conjugate acid of cis-cinnamate (CHEBI:35700) |
| Incoming Relation(s) |
| cis-ferulic acid (CHEBI:76117) has functional parent cis-cinnamic acid (CHEBI:35699) |
| methyl cis-cinnamate (CHEBI:194139) has functional parent cis-cinnamic acid (CHEBI:35699) |
| cis-cinnamate (CHEBI:35700) is conjugate base of cis-cinnamic acid (CHEBI:35699) |
| IUPAC Name |
|---|
| (2Z)-3-phenylprop-2-enoic acid |
| Synonyms | Source |
|---|---|
| (2Z)-3-phenyl-2-propenoic acid | NIST Chemistry WebBook |
| (2Z)-3-phenylacrylic acid | ChEBI |
| cis-cinnamic acid | NIST Chemistry WebBook |
| cis-Zimtsäure | ChEBI |
| cis-β-carboxystyrene | NIST Chemistry WebBook |
| (Z)-3-phenyl-2-propenoic acid | NIST Chemistry WebBook |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2040579 | Reaxys |
| Gmelin:279588 | Gmelin |
| CAS:102-94-3 | NIST Chemistry WebBook |