EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:76072 - nicotinic acid-adenine dinucleotide phosphate
| Formula | C21H28N6O18P3 |
| Net Charge | +1 |
| Average Mass | 745.401 |
| Monoisotopic Mass | 745.06674 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H]([n+]3cccc(C(=O)O)c3)[C@H](O)[C@@H]2O)[C@@H](O)[C@H]1OP(=O)(O)O |
| InChI | InChI=1S/C21H27N6O18P3/c22-17-12-18(24-7-23-17)27(8-25-12)20-16(44-46(33,34)35)14(29)11(43-20)6-41-48(38,39)45-47(36,37)40-5-10-13(28)15(30)19(42-10)26-3-1-2-9(4-26)21(31)32/h1-4,7-8,10-11,13-16,19-20,28-30H,5-6H2,(H6-,22,23,24,31,32,33,34,35,36,37,38,39)/p+1/t10-,11-,13-,14-,15-,16-,19-,20-/m1/s1 |
| InChIKey | QOTXBMGJKFVZRD-HISDBWNOSA-O |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. calcium channel agonist Agents that increase calcium influx into calcium channels of excitable tissues. signalling molecule A molecular messenger in which the molecule is specifically involved in transmitting information between cells. Such molecules are released from the cell sending the signal, cross over the gap between cells by diffusion, and interact with specific receptors in another cell, triggering a response in that cell by activating a series of enzyme controlled reactions which lead to changes inside the cell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nicotinic acid-adenine dinucleotide phosphate (CHEBI:76072) has functional parent NADP+ (CHEBI:18009) |
| nicotinic acid-adenine dinucleotide phosphate (CHEBI:76072) has role calcium channel agonist (CHEBI:38807) |
| nicotinic acid-adenine dinucleotide phosphate (CHEBI:76072) has role metabolite (CHEBI:25212) |
| nicotinic acid-adenine dinucleotide phosphate (CHEBI:76072) has role signalling molecule (CHEBI:62488) |
| nicotinic acid-adenine dinucleotide phosphate (CHEBI:76072) is a nicotinic acid dinucleotide (CHEBI:37584) |
| nicotinic acid-adenine dinucleotide phosphate (CHEBI:76072) is conjugate acid of nicotinate-adenine dinucleotide phosphate(4−) (CHEBI:75967) |
| Incoming Relation(s) |
| nicotinate-adenine dinucleotide phosphate(4−) (CHEBI:75967) is conjugate base of nicotinic acid-adenine dinucleotide phosphate (CHEBI:76072) |
| IUPAC Name |
|---|
| 2'-O-phosphonoadenosine 5'-{3-[1-(3-carboxypyridinio)-1,4-anhydro-D-ribitol-5-yl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| NAADP | MetaCyc |
| NAADP+ | MetaCyc |
| NAADP(1+) | ChEBI |
| nicotinic acid-adenine dinucleotide phosphate(1+) | ChEBI |
| Citations |
|---|