EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H29N7O17P3 |
| Net Charge | +1 |
| Average Mass | 744.417 |
| Monoisotopic Mass | 744.08273 |
| SMILES | NC(=O)c1ccc[n+]([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n4cnc5c(N)ncnc54)[C@H](OP(=O)(O)O)[C@@H]3O)[C@@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C21H28N7O17P3/c22-17-12-19(25-7-24-17)28(8-26-12)21-16(44-46(33,34)35)14(30)11(43-21)6-41-48(38,39)45-47(36,37)40-5-10-13(29)15(31)20(42-10)27-3-1-2-9(4-27)18(23)32/h1-4,7-8,10-11,13-16,20-21,29-31H,5-6H2,(H7-,22,23,24,25,32,33,34,35,36,37,38,39)/p+1/t10-,11-,13-,14-,15-,16-,20-,21-/m1/s1 |
| InChIKey | XJLXINKUBYWONI-NNYOXOHSSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | fundamental metabolite Any metabolite produced by all living cells. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NADP+ (CHEBI:18009) has role cofactor (CHEBI:23357) |
| NADP+ (CHEBI:18009) has role fundamental metabolite (CHEBI:78675) |
| NADP+ (CHEBI:18009) is a NAD(P)+ (CHEBI:13390) |
| NADP+ (CHEBI:18009) is a NADP (CHEBI:25523) |
| NADP+ (CHEBI:18009) is conjugate acid of NADP zwitterion (CHEBI:44409) |
| NADP+ (CHEBI:18009) is conjugate acid of NADP(3−) (CHEBI:58349) |
| Incoming Relation(s) |
| nicotinic acid-adenine dinucleotide phosphate (CHEBI:76072) has functional parent NADP+ (CHEBI:18009) |
| NADP zwitterion (CHEBI:44409) is conjugate base of NADP+ (CHEBI:18009) |
| NADP(3−) (CHEBI:58349) is conjugate base of NADP+ (CHEBI:18009) |
| IUPAC Name |
|---|
| 2'-O-phosphonoadenosine 5'-{3-[1-(3-carbamoylpyridinio)-1,4-anhydro-D-ribitol-5-yl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| beta-nicotinamide adenine dinucleotide phosphate | ChEBI |
| beta-Nicotinamide adenine dinucleotide phosphate | KEGG COMPOUND |
| NADP | KEGG COMPOUND |
| NADP+ | KEGG COMPOUND |
| Nicotinamide adenine dinucleotide phosphate | KEGG COMPOUND |
| oxidized nicotinamide-adenine dinucleotide phosphate | IUBMB |