EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:18009 - NADP+
| Formula | C21H29N7O17P3 |
| Net Charge | +1 |
| Average Mass | 744.417 |
| Monoisotopic Mass | 744.08273 |
| SMILES | NC(=O)c1ccc[n+]([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n4cnc5c(N)ncnc54)[C@H](OP(=O)(O)O)[C@@H]3O)[C@@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C21H28N7O17P3/c22-17-12-19(25-7-24-17)28(8-26-12)21-16(44-46(33,34)35)14(30)11(43-21)6-41-48(38,39)45-47(36,37)40-5-10-13(29)15(31)20(42-10)27-3-1-2-9(4-27)18(23)32/h1-4,7-8,10-11,13-16,20-21,29-31H,5-6H2,(H7-,22,23,24,25,32,33,34,35,36,37,38,39)/p+1/t10-,11-,13-,14-,15-,16-,20-,21-/m1/s1 |
| InChIKey | XJLXINKUBYWONI-NNYOXOHSSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). fundamental metabolite Any metabolite produced by all living cells. coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NADP+ (CHEBI:18009) has role cofactor (CHEBI:23357) |
| NADP+ (CHEBI:18009) has role fundamental metabolite (CHEBI:78675) |
| NADP+ (CHEBI:18009) is a NAD(P)+ (CHEBI:13390) |
| NADP+ (CHEBI:18009) is a NADP (CHEBI:25523) |
| NADP+ (CHEBI:18009) is conjugate acid of NADP zwitterion (CHEBI:44409) |
| NADP+ (CHEBI:18009) is conjugate acid of NADP(3−) (CHEBI:58349) |
| Incoming Relation(s) |
| nicotinic acid-adenine dinucleotide phosphate (CHEBI:76072) has functional parent NADP+ (CHEBI:18009) |
| NADP zwitterion (CHEBI:44409) is conjugate base of NADP+ (CHEBI:18009) |
| NADP(3−) (CHEBI:58349) is conjugate base of NADP+ (CHEBI:18009) |
| IUPAC Name |
|---|
| 2'-O-phosphonoadenosine 5'-{3-[1-(3-carbamoylpyridinio)-1,4-anhydro-D-ribitol-5-yl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| beta-nicotinamide adenine dinucleotide phosphate | ChEBI |
| beta-Nicotinamide adenine dinucleotide phosphate | KEGG COMPOUND |
| NADP | KEGG COMPOUND |
| NADP+ | KEGG COMPOUND |
| Nicotinamide adenine dinucleotide phosphate | KEGG COMPOUND |
| oxidized nicotinamide-adenine dinucleotide phosphate | IUBMB |