EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H23N6O18P3 |
| Net Charge | -4 |
| Average Mass | 740.361 |
| Monoisotopic Mass | 740.03036 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])OP(=O)([O-])OC[C@H]2O[C@@H]([n+]3cccc(C(=O)[O-])c3)[C@H](O)[C@@H]2O)[C@@H](O)[C@H]1OP(=O)([O-])[O-] |
| InChI | InChI=1S/C21H27N6O18P3/c22-17-12-18(24-7-23-17)27(8-25-12)20-16(44-46(33,34)35)14(29)11(43-20)6-41-48(38,39)45-47(36,37)40-5-10-13(28)15(30)19(42-10)26-3-1-2-9(4-26)21(31)32/h1-4,7-8,10-11,13-16,19-20,28-30H,5-6H2,(H6-,22,23,24,31,32,33,34,35,36,37,38,39)/p-4/t10-,11-,13-,14-,15-,16-,19-,20-/m1/s1 |
| InChIKey | QOTXBMGJKFVZRD-HISDBWNOSA-J |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nicotinate-adenine dinucleotide phosphate(4−) (CHEBI:75967) is a organophosphate oxoanion (CHEBI:58945) |
| nicotinate-adenine dinucleotide phosphate(4−) (CHEBI:75967) is conjugate base of nicotinic acid-adenine dinucleotide phosphate (CHEBI:76072) |
| Incoming Relation(s) |
| nicotinic acid-adenine dinucleotide phosphate (CHEBI:76072) is conjugate acid of nicotinate-adenine dinucleotide phosphate(4−) (CHEBI:75967) |
| Synonyms | Source |
|---|---|
| NAADP(4+) | ChEBI |
| nicotinate-adenine dinucleotide phosphate(4−) | ChEBI |
| UniProt Name | Source |
|---|---|
| NAADP(+) | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-15009 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11025115 | Reaxys |
| Citations |
|---|