EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H15NO2 |
| Net Charge | 0 |
| Average Mass | 265.312 |
| Monoisotopic Mass | 265.11028 |
| SMILES | [H][C@@]12Cc3ccccc3-c3c4c(cc(c31)CCN2)OCO4 |
| InChI | InChI=1S/C17H15NO2/c1-2-4-12-10(3-1)7-13-15-11(5-6-18-13)8-14-17(16(12)15)20-9-19-14/h1-4,8,13,18H,5-7,9H2/t13-/m1/s1 |
| InChIKey | VZTUKBKUWSHDFM-CYBMUJFWSA-N |
| Roles Classification |
|---|
| Biological Roles: | antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-annonaine (CHEBI:76) has parent hydride aporphine (CHEBI:35643) |
| (−)-annonaine (CHEBI:76) has role antineoplastic agent (CHEBI:35610) |
| (−)-annonaine (CHEBI:76) has role antiplasmodial drug (CHEBI:64915) |
| (−)-annonaine (CHEBI:76) has role trypanocidal drug (CHEBI:36335) |
| (−)-annonaine (CHEBI:76) is a aporphine alkaloid (CHEBI:134209) |
| (−)-annonaine (CHEBI:76) is a organic heteropentacyclic compound (CHEBI:38164) |
| (−)-annonaine (CHEBI:76) is a oxacycle (CHEBI:38104) |
| Incoming Relation(s) |
| bidebiline C (CHEBI:65492) has functional parent (−)-annonaine (CHEBI:76) |
| bidebiline D (CHEBI:65493) has functional parent (−)-annonaine (CHEBI:76) |
| IUPAC Name |
|---|
| (7aR)-6,7,7a,8-tetrahydro-5H-[1,3]benzodioxolo[6,5,4-de]benzo[g]quinoline |
| Synonyms | Source |
|---|---|
| (-)-Annonaine | KEGG COMPOUND |
| Anonaine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C09339 | KEGG COMPOUND |
| HMDB0030348 | HMDB |
| C00001807 | KNApSAcK |
| C00027281 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:90236 | Reaxys |
| CAS:1862-41-5 | KEGG COMPOUND |
| Citations |
|---|