EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H32O3 |
| Net Charge | 0 |
| Average Mass | 272.429 |
| Monoisotopic Mass | 272.23514 |
| SMILES | CCCCCCCCCCCCCC[C@@H](O)C(=O)O |
| InChI | InChI=1S/C16H32O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(17)16(18)19/h15,17H,2-14H2,1H3,(H,18,19)/t15-/m1/s1 |
| InChIKey | JGHSBPIZNUXPLA-OAHLLOKOSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-2-hydroxyhexadecanoic acid (CHEBI:75972) is a 2-hydroxyhexadecanoic acid (CHEBI:65101) |
| (R)-2-hydroxyhexadecanoic acid (CHEBI:75972) is conjugate acid of (R)-2-hydroxyhexadecanoate (CHEBI:75927) |
| (R)-2-hydroxyhexadecanoic acid (CHEBI:75972) is enantiomer of (S)-2-hydroxyhexadecanoic acid (CHEBI:75977) |
| Incoming Relation(s) |
| (R)-2-hydroxyhexadecanoyl-CoA (CHEBI:139375) has functional parent (R)-2-hydroxyhexadecanoic acid (CHEBI:75972) |
| (R)-2-hydroxyhexadecanoate (CHEBI:75927) is conjugate base of (R)-2-hydroxyhexadecanoic acid (CHEBI:75972) |
| (S)-2-hydroxyhexadecanoic acid (CHEBI:75977) is enantiomer of (R)-2-hydroxyhexadecanoic acid (CHEBI:75972) |
| IUPAC Name |
|---|
| (2R)-2-hydroxyhexadecanoic acid |
| Synonyms | Source |
|---|---|
| (R)-2-hydroxypalmitic acid | ChEBI |
| (R)-2OH PA | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050423 | LIPID MAPS |
| HMDB0031057 | HMDB |
| CPD-14716 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1726514 | Reaxys |
| CAS:16452-51-0 | HMDB |