EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H31O3 |
| Net Charge | -1 |
| Average Mass | 271.421 |
| Monoisotopic Mass | 271.22787 |
| SMILES | CCCCCCCCCCCCCC[C@@H](O)C(=O)[O-] |
| InChI | InChI=1S/C16H32O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(17)16(18)19/h15,17H,2-14H2,1H3,(H,18,19)/p-1/t15-/m1/s1 |
| InChIKey | JGHSBPIZNUXPLA-OAHLLOKOSA-M |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-2-hydroxyhexadecanoate (CHEBI:75927) is a (2R)-2-hydroxy fatty acid anion (CHEBI:76177) |
| (R)-2-hydroxyhexadecanoate (CHEBI:75927) is a 2-hydroxyhexadecanoate (CHEBI:65097) |
| (R)-2-hydroxyhexadecanoate (CHEBI:75927) is conjugate base of (R)-2-hydroxyhexadecanoic acid (CHEBI:75972) |
| (R)-2-hydroxyhexadecanoate (CHEBI:75927) is enantiomer of (S)-2-hydroxyhexadecanoate (CHEBI:75928) |
| Incoming Relation(s) |
| (R)-2-hydroxyhexadecanoic acid (CHEBI:75972) is conjugate acid of (R)-2-hydroxyhexadecanoate (CHEBI:75927) |
| (S)-2-hydroxyhexadecanoate (CHEBI:75928) is enantiomer of (R)-2-hydroxyhexadecanoate (CHEBI:75927) |
| IUPAC Name |
|---|
| (2R)-2-hydroxyhexadecanoate |
| Synonym | Source |
|---|---|
| (R)-2-hydroxypalmitate | ChEBI |
| UniProt Name | Source |
|---|---|
| (R)-2-hydroxyhexadecanoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-14716 | MetaCyc |