EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:65101 - 2-hydroxyhexadecanoic acid
| Formula | C16H32O3 |
| Net Charge | 0 |
| Average Mass | 272.429 |
| Monoisotopic Mass | 272.23514 |
| SMILES | CCCCCCCCCCCCCCC(O)C(=O)O |
| InChI | InChI=1S/C16H32O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(17)16(18)19/h15,17H,2-14H2,1H3,(H,18,19) |
| InChIKey | JGHSBPIZNUXPLA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxyhexadecanoic acid (CHEBI:65101) has role human metabolite (CHEBI:77746) |
| 2-hydroxyhexadecanoic acid (CHEBI:65101) is a 2-hydroxy fatty acid (CHEBI:10283) |
| 2-hydroxyhexadecanoic acid (CHEBI:65101) is a hydroxypalmitic acid (CHEBI:72726) |
| 2-hydroxyhexadecanoic acid (CHEBI:65101) is conjugate acid of 2-hydroxyhexadecanoate (CHEBI:65097) |
| Incoming Relation(s) |
| N-2-hydroxypalmitoylsphingosine (CHEBI:76751) has functional parent 2-hydroxyhexadecanoic acid (CHEBI:65101) |
| 2-hydroxyhexadecanoyl-CoA (CHEBI:74137) has functional parent 2-hydroxyhexadecanoic acid (CHEBI:65101) |
| (R)-2-hydroxyhexadecanoic acid (CHEBI:75972) is a 2-hydroxyhexadecanoic acid (CHEBI:65101) |
| (S)-2-hydroxyhexadecanoic acid (CHEBI:75977) is a 2-hydroxyhexadecanoic acid (CHEBI:65101) |
| 2-hydroxyhexadecanoate (CHEBI:65097) is conjugate base of 2-hydroxyhexadecanoic acid (CHEBI:65101) |
| IUPAC Name |
|---|
| 2-hydroxyhexadecanoic acid |
| Synonym | Source |
|---|---|
| 2-hydroxypalmitic acid | ChEBI |
| Citations |
|---|