EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H31O3 |
| Net Charge | -1 |
| Average Mass | 271.421 |
| Monoisotopic Mass | 271.22787 |
| SMILES | CCCCCCCCCCCCCCC(O)C(=O)[O-] |
| InChI | InChI=1S/C16H32O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(17)16(18)19/h15,17H,2-14H2,1H3,(H,18,19)/p-1 |
| InChIKey | JGHSBPIZNUXPLA-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (21886157) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxyhexadecanoate (CHEBI:65097) has functional parent hexadecanoate (CHEBI:7896) |
| 2-hydroxyhexadecanoate (CHEBI:65097) has role human metabolite (CHEBI:77746) |
| 2-hydroxyhexadecanoate (CHEBI:65097) is a 2-hydroxy fatty acid anion 16:0 (CHEBI:139189) |
| 2-hydroxyhexadecanoate (CHEBI:65097) is a long-chain fatty acid anion (CHEBI:57560) |
| 2-hydroxyhexadecanoate (CHEBI:65097) is conjugate base of 2-hydroxyhexadecanoic acid (CHEBI:65101) |
| Incoming Relation(s) |
| (R)-2-hydroxyhexadecanoate (CHEBI:75927) is a 2-hydroxyhexadecanoate (CHEBI:65097) |
| (S)-2-hydroxyhexadecanoate (CHEBI:75928) is a 2-hydroxyhexadecanoate (CHEBI:65097) |
| 2-hydroxyhexadecanoic acid (CHEBI:65101) is conjugate acid of 2-hydroxyhexadecanoate (CHEBI:65097) |
| IUPAC Name |
|---|
| 2-hydroxyhexadecanoate |
| Synonym | Source |
|---|---|
| 2-hydroxypalmitate | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-hydroxyhexadecanoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-8475 | MetaCyc |
| Citations |
|---|