EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12NO3.Na |
| Net Charge | 0 |
| Average Mass | 277.255 |
| Monoisotopic Mass | 277.07149 |
| SMILES | Nc1c(CC(=O)[O-])cccc1C(=O)c1ccccc1.[Na+] |
| InChI | InChI=1S/C15H13NO3.Na/c16-14-11(9-13(17)18)7-4-8-12(14)15(19)10-5-2-1-3-6-10;/h1-8H,9,16H2,(H,17,18);/q;+1/p-1 |
| InChIKey | MJAQSCHBMPGJES-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | cyclooxygenase 1 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 1. cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium (2-amino-3-benzoylphenyl)acetate (CHEBI:75918) has part amfenac(1−) (CHEBI:75917) |
| sodium (2-amino-3-benzoylphenyl)acetate (CHEBI:75918) has role cyclooxygenase 1 inhibitor (CHEBI:50630) |
| sodium (2-amino-3-benzoylphenyl)acetate (CHEBI:75918) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| sodium (2-amino-3-benzoylphenyl)acetate (CHEBI:75918) is a organic sodium salt (CHEBI:38700) |
| Incoming Relation(s) |
| amfenac sodium hydrate (CHEBI:31202) has part sodium (2-amino-3-benzoylphenyl)acetate (CHEBI:75918) |
| IUPAC Name |
|---|
| sodium (2-amino-3-benzoylphenyl)acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4283561 | Reaxys |
| CAS:61941-56-8 | ChemIDplus |