EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12NO3.H2O.Na |
| Net Charge | 0 |
| Average Mass | 295.270 |
| Monoisotopic Mass | 295.08205 |
| SMILES | Nc1c(CC(=O)[O-])cccc1C(=O)c1ccccc1.O.[Na+] |
| InChI | InChI=1S/C15H13NO3.Na.H2O/c16-14-11(9-13(17)18)7-4-8-12(14)15(19)10-5-2-1-3-6-10;;/h1-8H,9,16H2,(H,17,18);;1H2/q;+1;/p-1 |
| InChIKey | QZNJPJDUBTYMRS-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. cyclooxygenase 1 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 1. cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amfenac sodium hydrate (CHEBI:31202) has part sodium (2-amino-3-benzoylphenyl)acetate (CHEBI:75918) |
| amfenac sodium hydrate (CHEBI:31202) has role antipyretic (CHEBI:35493) |
| amfenac sodium hydrate (CHEBI:31202) has role cyclooxygenase 1 inhibitor (CHEBI:50630) |
| amfenac sodium hydrate (CHEBI:31202) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| amfenac sodium hydrate (CHEBI:31202) has role non-narcotic analgesic (CHEBI:35481) |
| amfenac sodium hydrate (CHEBI:31202) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| amfenac sodium hydrate (CHEBI:31202) is a hydrate (CHEBI:35505) |
| IUPAC Name |
|---|
| sodium (2-amino-3-benzoylphenyl)acetate—water (1/1) |
| Synonyms | Source |
|---|---|
| 2-amino-3-benzoylbenzeneacetic acid, monosodium salt, monohydrate | ChemIDplus |
| AHR-5850D | ChemIDplus |
| amfenac sodium | ChemIDplus |
| sodium (2-amino-3-benzoylphenyl)acetate monohydrate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D01788 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13313120 | Reaxys |
| CAS:61618-27-7 | KEGG DRUG |
| CAS:61618-27-7 | ChemIDplus |
| Citations |
|---|