EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H13NO3 |
| Net Charge | 0 |
| Average Mass | 255.273 |
| Monoisotopic Mass | 255.08954 |
| SMILES | Nc1c(CC(=O)O)cccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H13NO3/c16-14-11(9-13(17)18)7-4-8-12(14)15(19)10-5-2-1-3-6-10/h1-8H,9,16H2,(H,17,18) |
| InChIKey | SOYCMDCMZDHQFP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | cyclooxygenase 1 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 1. cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amfenac (CHEBI:75915) has role antipyretic (CHEBI:35493) |
| amfenac (CHEBI:75915) has role cyclooxygenase 1 inhibitor (CHEBI:50630) |
| amfenac (CHEBI:75915) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| amfenac (CHEBI:75915) has role non-narcotic analgesic (CHEBI:35481) |
| amfenac (CHEBI:75915) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| amfenac (CHEBI:75915) is a amino acid (CHEBI:33709) |
| amfenac (CHEBI:75915) is a benzophenones (CHEBI:22726) |
| amfenac (CHEBI:75915) is a oxo monocarboxylic acid (CHEBI:35871) |
| amfenac (CHEBI:75915) is a primary amino compound (CHEBI:50994) |
| amfenac (CHEBI:75915) is a substituted aniline (CHEBI:48975) |
| amfenac (CHEBI:75915) is conjugate acid of amfenac(1−) (CHEBI:75917) |
| Incoming Relation(s) |
| bromfenac (CHEBI:240107) has functional parent amfenac (CHEBI:75915) |
| amfenac(1−) (CHEBI:75917) is conjugate base of amfenac (CHEBI:75915) |
| IUPAC Name |
|---|
| (2-amino-3-benzoylphenyl)acetic acid |
| INNs | Source |
|---|---|
| amfenac | ChemIDplus |
| amfénac | WHO MedNet |
| amfenaco | ChemIDplus |
| amfenacum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-amino-3-benzoylbenzeneacetic acid | ChEBI |
| (2-Amino-3-benzoylphenyl)essigsaeure | ChemIDplus |
| Citations |
|---|