EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:240107 - bromfenac
| Formula | C15H12BrNO3 |
| Net Charge | 0 |
| Average Mass | 334.169 |
| Monoisotopic Mass | 333.00006 |
| SMILES | Nc1c(CC(=O)O)cccc1C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H12BrNO3/c16-11-6-4-9(5-7-11)15(20)12-3-1-2-10(14(12)17)8-13(18)19/h1-7H,8,17H2,(H,18,19) |
| InChIKey | ZBPLOVFIXSTCRZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bromfenac (CHEBI:240107) has functional parent amfenac (CHEBI:75915) |
| bromfenac (CHEBI:240107) has role non-narcotic analgesic (CHEBI:35481) |
| bromfenac (CHEBI:240107) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| bromfenac (CHEBI:240107) is a aromatic amino acid (CHEBI:33856) |
| bromfenac (CHEBI:240107) is a benzophenones (CHEBI:22726) |
| bromfenac (CHEBI:240107) is a organobromine compound (CHEBI:37141) |
| bromfenac (CHEBI:240107) is a substituted aniline (CHEBI:48975) |
| bromfenac (CHEBI:240107) is conjugate acid of bromfenac(1−) (CHEBI:59175) |
| Incoming Relation(s) |
| bromfenac(1−) (CHEBI:59175) is conjugate base of bromfenac (CHEBI:240107) |
| IUPAC Name |
|---|
| [2-amino-3-(4-bromobenzoyl)phenyl]acetic acid |
| INNs | Source |
|---|---|
| bromfenac | ChemIDplus |
| bromfenaco | ChemIDplus |
| bromfenacum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-amino-3-(4-bromobenzoyl)benzeneacetic acid | ChemIDplus |
| [2-Amino-3-(4-bromo-benzoyl)-phenyl]-acetic acid | ChEMBL |