EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:240107 - bromfenac
| Formula | C15H12BrNO3 |
| Net Charge | 0 |
| Average Mass | 334.169 |
| Monoisotopic Mass | 333.00006 |
| SMILES | Nc1c(CC(=O)O)cccc1C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H12BrNO3/c16-11-6-4-9(5-7-11)15(20)12-3-1-2-10(14(12)17)8-13(18)19/h1-7H,8,17H2,(H,18,19) |
| InChIKey | ZBPLOVFIXSTCRZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bromfenac (CHEBI:240107) has functional parent amfenac (CHEBI:75915) |
| bromfenac (CHEBI:240107) has role anti-inflammatory agent (CHEBI:67079) |
| bromfenac (CHEBI:240107) has role non-narcotic analgesic (CHEBI:35481) |
| bromfenac (CHEBI:240107) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| bromfenac (CHEBI:240107) has role ophthalmology drug (CHEBI:66981) |
| bromfenac (CHEBI:240107) is a aromatic amino acid (CHEBI:33856) |
| bromfenac (CHEBI:240107) is a benzophenones (CHEBI:22726) |
| bromfenac (CHEBI:240107) is a organobromine compound (CHEBI:37141) |
| bromfenac (CHEBI:240107) is a substituted aniline (CHEBI:48975) |
| bromfenac (CHEBI:240107) is conjugate acid of bromfenac(1−) (CHEBI:59175) |
| Incoming Relation(s) |
| bromfenac(1−) (CHEBI:59175) is conjugate base of bromfenac (CHEBI:240107) |
| IUPAC Name |
|---|
| [2-amino-3-(4-bromobenzoyl)phenyl]acetic acid |
| INNs | Source |
|---|---|
| bromfenac | ChemIDplus |
| bromfenaco | ChemIDplus |
| bromfenacum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-amino-3-(4-bromobenzoyl)benzeneacetic acid | ChemIDplus |
| [2-Amino-3-(4-bromo-benzoyl)-phenyl]-acetic acid | ChEMBL |
| ISV-303 | ChEMBL |
| Citations |
|---|