EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O5 |
| Net Charge | 0 |
| Average Mass | 354.402 |
| Monoisotopic Mass | 354.14672 |
| SMILES | COC(=C\C(C)=C\C1CCCc2oc3ccc(O)cc3c21)/C=C/C(=O)O |
| InChI | InChI=1S/C21H22O5/c1-13(11-16(25-2)7-9-20(23)24)10-14-4-3-5-19-21(14)17-12-15(22)6-8-18(17)26-19/h6-12,14,22H,3-5H2,1-2H3,(H,23,24)/b9-7+,13-10+,16-11- |
| InChIKey | LWPQRRAIIWETLD-LUGDWHTQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cuevaene A (CHEBI:75881) has role metabolite (CHEBI:25212) |
| cuevaene A (CHEBI:75881) is a dibenzofurans (CHEBI:38922) |
| cuevaene A (CHEBI:75881) is a enol ether (CHEBI:47985) |
| cuevaene A (CHEBI:75881) is a phenols (CHEBI:33853) |
| cuevaene A (CHEBI:75881) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| (2E,4Z,6E)-7-(8-hydroxy-1,2,3,4-tetrahydrodibenzo[b,d]furan-1-yl)-4-methoxy-6-methylhepta-2,4,6-trienoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20668157 | Reaxys |
| Citations |
|---|