EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H11N3O3 |
| Net Charge | 0 |
| Average Mass | 281.271 |
| Monoisotopic Mass | 281.08004 |
| SMILES | O=C1CN=C(c2ccccc2)c2cc([N+](=O)[O-])ccc2N1 |
| InChI | InChI=1S/C15H11N3O3/c19-14-9-16-15(10-4-2-1-3-5-10)12-8-11(18(20)21)6-7-13(12)17-14/h1-8H,9H2,(H,17,19) |
| InChIKey | KJONHKAYOJNZEC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| Applications: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. anticonvulsant A drug used to prevent seizures or reduce their severity. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nitrazepam (CHEBI:7581) has role anticonvulsant (CHEBI:35623) |
| nitrazepam (CHEBI:7581) has role antispasmodic drug (CHEBI:53784) |
| nitrazepam (CHEBI:7581) has role drug metabolite (CHEBI:49103) |
| nitrazepam (CHEBI:7581) has role GABA modulator (CHEBI:50268) |
| nitrazepam (CHEBI:7581) has role sedative (CHEBI:35717) |
| nitrazepam (CHEBI:7581) is a C-nitro compound (CHEBI:35716) |
| nitrazepam (CHEBI:7581) is a 1,4-benzodiazepinone (CHEBI:35500) |
| Incoming Relation(s) |
| nimetazepam (CHEBI:31912) has functional parent nitrazepam (CHEBI:7581) |
| IUPAC Name |
|---|
| 7-nitro-5-phenyl-1,3-dihydro-2H-1,4-benzodiazepin-2-one |
| INNs | Source |
|---|---|
| nitrazepam | WHO MedNet |
| nitrazepamum | WHO MedNet |
| nitrazépam | WHO MedNet |
| nitrazepam | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2,3-dihydro-7-nitro-5-phenyl-1H-1,4-benzodiazepin-2-one | NIST Chemistry WebBook |
| 1,3-dihydro-7-nitro-5-phenyl-2H-1,4-benzodiazepin-2-one | NIST Chemistry WebBook |
| 7-nitro-5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-2-one | NIST Chemistry WebBook |
| N-desmethylnimetazepam | NIST Chemistry WebBook |
| 7-nitro-1,3-dihydro-5-phenyl-2H-1,4-benzodiazepin-2-one | NIST Chemistry WebBook |
| Ro 5-3059 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Mogadon | NIST Chemistry WebBook |
| Relact | ChemIDplus |
| Imesont | ChemIDplus |
| Hipsal | ChemIDplus |
| Imeson | ChemIDplus |
| Nelbon | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C07487 | KEGG COMPOUND |
| DB01595 | DrugBank |
| US3121076 | Patent |
| HMDB0015534 | HMDB |
| Nitrazepam | Wikipedia |
| D00531 | KEGG DRUG |
| LSM-5681 | LINCS |
| 1945 | DrugCentral |
| Citations |
|---|