EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | OC[C@@H]1O[C@H](O)[C@@H](O)[C@H](O)[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a1211h-1b_1-5]/1/ |
| InChI | InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6-/m0/s1 |
| InChIKey | WQZGKKKJIJFFOK-QYESYBIKSA-N |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-L-glucose (CHEBI:37631) is a L-glucopyranose (CHEBI:37627) |
| β-L-glucose (CHEBI:37631) is enantiomer of β-D-glucose (CHEBI:15903) |
| Incoming Relation(s) |
| isorhamnetin 3-O-β-L-glucopyranoside (CHEBI:75758) has functional parent β-L-glucose (CHEBI:37631) |
| isorhamnetin 4'-O-β-D-glucopyranoside (CHEBI:75783) has functional parent β-L-glucose (CHEBI:37631) |
| isorhamnetin 4'-O-β-L-glucopyranoside (CHEBI:75778) has functional parent β-L-glucose (CHEBI:37631) |
| isorhamnetin 7-O-β-L-glucopyranoside (CHEBI:75773) has functional parent β-L-glucose (CHEBI:37631) |
| kaempferol 3-O-β-L-glucopyranoside (CHEBI:75791) has functional parent β-L-glucose (CHEBI:37631) |
| kaempferol 5-O-β-L-glucopyranoside (CHEBI:75805) has functional parent β-L-glucose (CHEBI:37631) |
| β-D-glucose (CHEBI:15903) is enantiomer of β-L-glucose (CHEBI:37631) |
| IUPAC Name |
|---|
| β-L-glucopyranose |
| Manual Xrefs | Databases |
|---|---|
| G59396XU | GlyTouCan |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1907373 | Reaxys |