EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H30O16 |
| Net Charge | 0 |
| Average Mass | 730.631 |
| Monoisotopic Mass | 730.15338 |
| SMILES | O=C(O[C@H]1[C@H](c2c(O)cc(O)c3c2O[C@H](c2ccc(O)c(O)c2)[C@@H](O)C3)c2c(O)cc(O)cc2O[C@@H]1c1ccc(O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C37H30O16/c38-16-9-23(44)29-28(10-16)51-34(14-2-4-19(40)22(43)6-14)36(53-37(50)15-7-25(46)32(49)26(47)8-15)31(29)30-24(45)12-20(41)17-11-27(48)33(52-35(17)30)13-1-3-18(39)21(42)5-13/h1-10,12,27,31,33-34,36,38-49H,11H2/t27-,31-,33+,34+,36-/m0/s1 |
| InChIKey | BXWABJPTCUDBMM-UDGCLMCYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| procyanidin B3 3-O-gallate (CHEBI:75656) has functional parent gallic acid (CHEBI:30778) |
| procyanidin B3 3-O-gallate (CHEBI:75656) has functional parent procyanidin B3 (CHEBI:75630) |
| procyanidin B3 3-O-gallate (CHEBI:75656) has role metabolite (CHEBI:25212) |
| procyanidin B3 3-O-gallate (CHEBI:75656) is a biflavonoid (CHEBI:50128) |
| procyanidin B3 3-O-gallate (CHEBI:75656) is a gallate ester (CHEBI:37576) |
| procyanidin B3 3-O-gallate (CHEBI:75656) is a polyphenol (CHEBI:26195) |
| procyanidin B3 3-O-gallate (CHEBI:75656) is a proanthocyanidin (CHEBI:26267) |
| IUPAC Name |
|---|
| (2R,2'R,3S,3'S,4S)-2,2'-bis(3,4-dihydroxyphenyl)-3',5,5',7,7'-pentahydroxy-3,3',4,4'-tetrahydro-2H,2'H-4,8'-bichromen-3-yl 3,4,5-trihydroxybenzoate |
| Synonym | Source |
|---|---|
| (+)-catechin-(4α→8)-(+)-catechin-3-O-gallate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6766651 | Reaxys |